CAS 28152-73-0
:(+)-Vincaminic acid
Description:
(+)-Vincaminic acid is a naturally occurring alkaloid derived from the Vinca minor plant, commonly known as periwinkle. It is characterized by its complex structure, which includes a bicyclic framework and various functional groups that contribute to its biological activity. This compound is known for its potential neuroprotective and cognitive-enhancing properties, making it of interest in pharmacological research. (+)-Vincaminic acid exhibits moderate solubility in water and is more soluble in organic solvents, which is typical for many alkaloids. Its molecular formula reflects a specific arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique chemical behavior. The compound has been studied for its effects on blood flow and its potential use in treating conditions related to cognitive decline. Additionally, its stereochemistry is significant, as the (+) designation indicates the specific spatial arrangement of atoms, which can influence its biological activity and interactions with receptors. Overall, (+)-Vincaminic acid represents a fascinating area of study within natural products and medicinal chemistry.
Formula:C20H24N2O3
InChI:InChI=1S/C20H24N2O3/c1-2-19-9-5-10-21-11-8-14-13-6-3-4-7-15(13)22(16(14)17(19)21)20(25,12-19)18(23)24/h3-4,6-7,17,25H,2,5,8-12H2,1H3,(H,23,24)/t17-,19+,20+/m1/s1
InChI key:InChIKey=UXMCFEBDJVHVNH-HOJAQTOUSA-N
SMILES:C(O)(=O)[C@]1(O)N2C=3[C@@]4([C@](CC)(C1)CCCN4CCC3C=5C2=CC=CC5)[H]
Synonyms:- (+)-Vincaminic acid
- (+)-cis-Vincaminic acid
- (3Alpha,14Beta,16Alpha)-14-Hydroxy-14,15-Dihydroeburnamenine-14-Carboxylic Acid
- (3alpha,14beta,16alpha)-14,15-Dihydro-14-hydroxyeburnamenine-14-carboxylic acid
- Eburnamenine-14-carboxylic acid, 14,15-dihydro-14-hydroxy-, (3α,14β,16α)-
- (3α,14β,16α)-14,15-Dihydro-14-hydroxyeburnamenine-14-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Vincamine Impurity 6
CAS:Formula:C20H24N2O3Color and Shape:White To Off-White SolidMolecular weight:340.42
