CymitQuimica logo

CAS 28165-52-8

:

2,5-dibromophenol

Description:
2,5-Dibromophenol is an organic compound characterized by the presence of two bromine atoms and one hydroxyl group (-OH) attached to a phenolic ring. Its molecular formula is C6H4Br2O, indicating that it contains six carbon atoms, four hydrogen atoms, two bromine atoms, and one oxygen atom. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the bromine substituents. 2,5-Dibromophenol exhibits properties typical of phenolic compounds, including the ability to act as a weak acid, donating a proton from the hydroxyl group. It is often used in various applications, including as an intermediate in organic synthesis and in the production of certain dyes and pharmaceuticals. Additionally, due to the presence of bromine, it may exhibit antimicrobial properties. However, safety precautions should be taken when handling this compound, as brominated compounds can be hazardous.
Formula:C6H4Br2O
InChI:InChI=1/C6H4Br2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H
InChI key:GUXWVUVLXIJHQF-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)O)Br
Synonyms:
  • Phenol, 2,5-Dibromo-
Found 5 products.