CAS 281658-42-2

3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridine

Description:

3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrrole moieties. This compound features a tetrahydropyridine substituent, contributing to its potential biological activity and interaction with various biological targets. The presence of nitrogen atoms in its structure enhances its ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and drug design. Its unique structural features may confer specific pharmacological properties, potentially influencing its solubility, stability, and reactivity. The compound's CAS number, 281658-42-2, allows for its identification in chemical databases, facilitating research and development efforts. Overall, this substance may exhibit interesting properties that warrant further investigation in the context of therapeutic applications, particularly in neurology or oncology, where similar compounds have shown promise.

Formula: C₁₂H₁₃N₃

InChI: InChI=1/C12H13N3/c1-2-10-11(8-15-12(10)14-5-1)9-3-6-13-7-4-9/h1-3,5,8,13H,4,6-7H2,(H,14,15)

SMILES: c1cc2c(c[nH]c2nc1)C1=CCNCC1

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 3-(1,2,3,6-tetrahydro-4-pyridinyl)-
• 3-(1,2,3,6-Tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin

3-(1,2,3,6-Tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridine

CAS: 281658-42-2

Formula: C₁₂H₁₃N₃

Molecular weight: 199.2517

Ref: IN-DA00BH59

4-{1H-pyrrolo[2,3-b]pyridin-3-yl}-1,2,3,6-tetrahydropyridine

CAS: 281658-42-2

Purity: 95+%

Molecular weight: 199.2570038

Ref: 10-F600211

4-{1H-Pyrrolo[2,3-b]pyridin-3-yl}-1,2,3,6-tetrahydropyridine

CAS: 281658-42-2

4-{1H-Pyrrolo[2,3-b]pyridin-3-yl}-1,2,3,6-tetrahydropyridine (4PP) is a dopamine D1 receptor agonist. It has been shown to inhibit signal pathways involving dopamine in the brain and to be effective in treating autoimmune diseases and metabolic disorders. 4PP is a cannabinoid derivative that exhibits locomotor activity in vivo. This drug binds to the cannabinoid receptor CB1 with high affinity but also displays selectivity for other targets such as the dopamine D1 receptor. The binding of 4PP with CB1 produces an increase in intracellular cAMP levels that lead to its antiproliferative effects on cancer cells. 4PP has been shown to have potent anti-inflammatory properties and can be used as an inhibitor of hepatic steatosis due to its ability to inhibit fatty acid synthesis by blocking the action of fatty acid synthase. The crystalline

Formula: C₁₂H₁₃N₃

Purity: Min. 95%

Molecular weight: 199.25 g/mol

Ref: 3D-GLA65842