CAS 28173-52-6
:beta-D-mannopyranosyl-(1->2)-[beta-D-mannopyranosyl-(1->3)]-D-mannose
Description:
Beta-D-mannopyranosyl-(1->2)-[beta-D-mannopyranosyl-(1->3)]-D-mannose, with the CAS number 28173-52-6, is a complex carbohydrate, specifically a type of oligosaccharide. It is composed of multiple D-mannose units linked through glycosidic bonds, which contribute to its structural characteristics. This compound exhibits properties typical of polysaccharides, such as solubility in water and the ability to form gels or viscous solutions. Its structure includes a pyranose ring, which is a six-membered ring containing oxygen, and the specific glycosidic linkages (1->2 and 1->3) define its unique connectivity and branching. This oligosaccharide may play roles in biological processes, including cell recognition and signaling, due to its potential interactions with proteins and other biomolecules. Additionally, it may be involved in various applications in the food and pharmaceutical industries, particularly in the development of prebiotics or as a functional ingredient. Understanding its characteristics is essential for exploring its potential uses and biological significance.
Formula:C18H32O16
InChI:InChI=1/C18H32O16/c19-1-5(23)9(24)16(34-18-15(30)13(28)11(26)7(3-21)32-18)8(4-22)33-17-14(29)12(27)10(25)6(2-20)31-17/h4-21,23-30H,1-3H2/t5-,6-,7-,8-,9-,10-,11-,12+,13+,14+,15+,16-,17+,18+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,4-b-D-Mannotriose
CAS:<p>Isolated from the partial acid and enzymic hydrolysates of several of the mannans, galactomannans and glucomannans. While the trisaccharide has been isolated from all of these sources the tetrasaccharide has only been isolated from ivory-nut mannan, white spruce (Picea glauca) and Pinus strobus glucomannans. Crystalline penta- and hexa-saccharides have been isolated from ivory-nut mannan hydrolysates.</p>Formula:C18H32O16Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:504.44 g/mol


