CAS 2819-61-6
:2-Hydroxy-N-(2-phenylethyl)benzamide
Description:
2-Hydroxy-N-(2-phenylethyl)benzamide, with the CAS number 2819-61-6, is an organic compound characterized by its amide functional group and a phenolic hydroxyl group. This compound features a benzamide structure where the amine is substituted with a 2-phenylethyl group, contributing to its unique properties. The presence of the hydroxyl group enhances its solubility in polar solvents and may impart some degree of acidity, allowing for potential interactions in biological systems. The compound is likely to exhibit moderate to high lipophilicity due to the phenyl groups, which can influence its pharmacokinetic properties if considered for medicinal applications. Additionally, the structural features suggest potential for hydrogen bonding, which can affect its reactivity and interactions with other molecules. Overall, 2-Hydroxy-N-(2-phenylethyl)benzamide may have applications in pharmaceuticals or as a chemical intermediate, although specific biological activities or uses would require further investigation.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c17-14-9-5-4-8-13(14)15(18)16-11-10-12-6-2-1-3-7-12/h1-9,17H,10-11H2,(H,16,18)
InChI key:InChIKey=QNXXBEKNVVQTRX-UHFFFAOYSA-N
SMILES:C(NCCC1=CC=CC=C1)(=O)C2=C(O)C=CC=C2
Synonyms:- NSC 9529
- Riparin C
- Salicylamide, N-phenethyl-
- benzamide, 2-hydroxy-N-(2-phenylethyl)-
- 2-Hydroxy-N-(2-phenylethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
