CAS 28199-69-1
:Dihydrodehydrodiconiferyl alcohol
Description:
Dihydrodehydrodiconiferyl alcohol, with the CAS number 28199-69-1, is a phenolic compound that is part of the lignin biosynthetic pathway. It is characterized by its complex structure, which includes multiple hydroxyl groups and a conjugated system that contributes to its chemical reactivity and potential biological activity. This compound is typically found in plant materials, particularly in the cell walls of certain species, where it plays a role in providing structural integrity and resistance to degradation. Dihydrodehydrodiconiferyl alcohol is known for its antioxidant properties, which may contribute to its protective functions in plants. Additionally, it can participate in various chemical reactions, including polymerization, which is significant in the context of lignin formation. Its solubility and stability can vary depending on the solvent and environmental conditions, making it a subject of interest in both natural product chemistry and materials science. Overall, this compound exemplifies the intricate chemistry of plant-derived substances and their potential applications in various fields.
Formula:C20H24O6
InChI:InChI=1S/C20H24O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h5-6,8-10,15,19,21-23H,3-4,7,11H2,1-2H3/t15-,19+/m0/s1
InChI key:InChIKey=SBLZVJIHPWRSQQ-HNAYVOBHSA-N
SMILES:C(O)[C@H]1C=2C(O[C@@]1(C3=CC(OC)=C(O)C=C3)[H])=C(OC)C=C(CCCO)C2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcoholPurity:≥95%Molecular weight:360.4g/molDihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcohol is the methanolic extract of Liriodendron tulipifera[1].Formula:C20H24O6Purity:96.50%Color and Shape:SolidMolecular weight:360.4(2S,3R)-Dihydrodehydroconiferyl Alcohol
CAS:Controlled ProductFormula:C20H24O6Color and Shape:NeatMolecular weight:360.401Dihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcohol is a lignan compound, which is a type of polyphenol. It is primarily sourced from plants, including species like conifers and other woody plants. The compound is notable for its ability to modulate various biochemical pathways, primarily through its antioxidant and anti-inflammatory activities. Its mode of action involves scavenging free radicals and inhibiting pro-inflammatory enzyme pathways, thereby reducing oxidative stress and inflammation at the cellular level.Formula:C20H24O6Purity:Min. 95%Molecular weight:360.4 g/mol




