CAS 28200-65-9

11-methoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one

Description:

11-Methoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one, with the CAS number 28200-65-9, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a quinoline core fused with a benzodioxole moiety. This compound typically exhibits properties such as fluorescence, making it of interest in various applications, including organic electronics and photonic devices. The presence of the methoxy group enhances its solubility and may influence its electronic properties. Additionally, compounds of this class often demonstrate biological activity, which can include antimicrobial or anticancer properties, although specific biological data for this compound may vary. Its unique structure allows for potential interactions with biological targets, making it a candidate for further pharmacological studies. As with many synthetic organic compounds, careful handling and characterization are essential due to potential toxicity and reactivity.

Formula: C₁₈H₁₁NO₄

InChI: InChI=1/C18H11NO4/c1-21-10-2-3-11-12(7-10)15-14-9(4-5-19-16(14)17(11)20)6-13-18(15)23-8-22-13/h2-7H,8H2,1H3

SMILES: COc1ccc2c(c1)c1c3c(ccnc3C2=O)cc2c1OCO2

Synonyms:

• 8H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinolin-8-one, 11-methoxy-
• Oxolaureline

Lauterine

CAS: 28200-65-9

Lauterine is a DNA topoisomerase inhibitor.

Formula: C₁₈H₁₁NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 305.28

Ref: TM-TN4422

Lauterine

CAS: 28200-65-9

Formula: C₁₈H₁₁NO₄

Purity: 95%~99%

Molecular weight: 305.289

Ref: BP-SBP03410

Lauterine

CAS: 28200-65-9

Lauterine is a microbial growth regulator, which is derived from specific bacterial sources. It functions by modulating the expression of key genes involved in cellular proliferation and differentiation within target microbial communities.

Formula: C₁₈H₁₁NO₄

Purity: Min. 95%

Molecular weight: 305.3 g/mol

Ref: 3D-DBA20065