CAS 2822-41-5
:2,3,4-Trifluorophenol
Description:
2,3,4-Trifluorophenol is an aromatic compound characterized by the presence of three fluorine atoms substituted on the phenolic ring at the 2, 3, and 4 positions relative to the hydroxyl (-OH) group. This trifluorinated derivative of phenol exhibits unique properties due to the electronegative fluorine atoms, which influence its reactivity and solubility. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a relatively high boiling point compared to non-fluorinated phenols, reflecting the strong intermolecular interactions due to hydrogen bonding and dipole-dipole interactions. 2,3,4-Trifluorophenol is known for its applications in organic synthesis, particularly as a building block in the production of pharmaceuticals and agrochemicals. Additionally, its fluorine substituents enhance its stability and lipophilicity, making it useful in various chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H3F3O
InChI:InChI=1/C6H3F3O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H
InChI key:IJGSULQFKYOYEU-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1F)F)F)O
Synonyms:- Phenol, 2,3,4-trifluoro-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,3,4-Trifluorophenol
CAS:Formula:C6H3F3OPurity:>98.0%(GC)Color and Shape:White or Colorless to Light orange to Yellow powder to lump to clear liquidMolecular weight:148.082,3,4-Trifluorophenol
CAS:2,3,4-TrifluorophenolFormula:C6H3F3OPurity:98%Color and Shape:SolidMolecular weight:148.082622,3,4-Trifluorophenol Hydrate
CAS:Controlled ProductApplications 2,3,4-Trifluorophenol Hydrate is a compound useful in organic synthesis.
Formula:C6H3F3O·xH2OColor and Shape:NeatMolecular weight:148.082,3,4-Trifluorophenol
CAS:2,3,4-Trifluorophenol is a chemical control agent that is used as an intermediate in the synthesis of organic compounds. It reacts with hydroxyl groups to form 2,3,4-trifluoroacetophenone from a proton. The compound has low light and x-ray absorption properties and is typically used in liquid crystal compositions. Chemical ionization experiments have shown that 2,3,4-trifluorophenol binds to copper oxide and forms copper trifluoride. This compound also has been found to be conjugated with neutral ph phenols and chlorinated with chlorine atom.
Formula:C6H3F3OPurity:Min. 95%Color and Shape:PowderMolecular weight:148.08 g/mol






