CAS 2822-50-6

3-Nitro-4-(trifluoromethoxy)aniline

Description:

3-Nitro-4-(trifluoromethoxy)aniline is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2) and a trifluoromethoxy group (-OCF3) attached to an aniline backbone. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and polarity. The trifluoromethoxy group enhances the compound's lipophilicity and can affect its solubility in various solvents. This compound is often used in the synthesis of pharmaceuticals and agrochemicals due to its unique electronic properties and potential biological activity. It may exhibit various physical properties such as melting point, boiling point, and solubility, which are influenced by its functional groups. Additionally, safety considerations are important, as nitro compounds can be hazardous, and proper handling and storage protocols should be followed. Overall, 3-Nitro-4-(trifluoromethoxy)aniline is a significant compound in organic chemistry with applications in research and industry.

Formula: C₇H₅F₃N₂O₃

InChI: InChI=1/C7H5F3N2O3/c8-7(9,10)15-6-2-1-4(11)3-5(6)12(13)14/h1-3H,11H2

SMILES: c1cc(c(cc1N)N(=O)=O)OC(F)(F)F

Synonyms:

• 4-(Trifluoromethoxy)-3-nitroaniline
• Benzenamine, 3-Nitro-4-(Trifluoromethoxy)-

3-Nitro-4-(trifluoromethoxy)aniline

CAS: 2822-50-6

Formula: C₇H₅F₃N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.1214

Ref: IN-DA0037PO

3-Nitro-4-(trifluoromethoxy)aniline

CAS: 2822-50-6

3-Nitro-4-(trifluoromethoxy)aniline

Formula: C₇H₅F₃N₂O₃

Purity: 98%

Color and Shape: brown solid

Molecular weight: 222.12g/mol

Ref: 54-PC1558

3-Nitro-4-(trifluoromethoxy)aniline

CAS: 2822-50-6

Formula: C₇H₅F₃N₂O₃

Purity: 97%

Molecular weight: 222.123

Ref: 10-F217541