
CAS 28221-20-7
:Validol
Description:
Validol, with the CAS number 28221-20-7, is a chemical compound primarily known for its use as a mild sedative and anxiolytic agent. It is a menthol derivative, specifically the menthyl ester of valeric acid, which contributes to its characteristic cooling sensation. Validol is often utilized in the form of tablets or drops, and it is commonly employed in the treatment of various conditions, including anxiety, stress, and mild heart-related symptoms, due to its calming effects. The compound is typically administered sublingually, allowing for rapid absorption into the bloodstream. Validol is generally considered safe for use, with a low incidence of side effects, although it may cause mild gastrointestinal disturbances in some individuals. Its mechanism of action is thought to involve the activation of certain receptors in the central nervous system, leading to a soothing effect. Overall, Validol is recognized for its therapeutic properties, particularly in the realm of complementary and alternative medicine.
Formula:C15H28O2
InChI:InChI=1S/C15H28O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h10-14H,6-9H2,1-5H3/t12-,13+,14-/m1/s1
InChI key:InChIKey=VYQSSWZYPCCBRN-HZSPNIEDSA-N
SMILES:C(C)(C)[C@H]1[C@H](OC(CC(C)C)=O)C[C@H](C)CC1
Synonyms:- Validol
- Butanoic acid, 3-methyl-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
- Menthol, isovalerate
- Menthoval
- Butanoic acid, 3-methyl-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-(1α,2β,5α)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
