
CAS 28223-40-7
:Lyxonic acid
Description:
Lyxonic acid, with the CAS number 28223-40-7, is a sugar acid derived from the aldopentose lyxose. It is characterized by its carboxylic acid functional group, which imparts acidic properties to the molecule. Lyxonic acid exists in a crystalline form and is typically soluble in water due to its polar nature. This compound is of interest in biochemical research and has potential applications in the synthesis of various organic compounds. Its structure features a five-carbon backbone, which is typical of pentoses, and it can participate in various chemical reactions, including esterification and oxidation. Lyxonic acid is also studied for its role in metabolic pathways and its potential effects on biological systems. As with many sugar acids, it may exhibit specific stereochemical configurations, influencing its reactivity and interactions with other biomolecules. Overall, lyxonic acid is a significant compound in the field of organic chemistry and biochemistry, contributing to our understanding of carbohydrate metabolism and organic synthesis.
Formula:C5H10O6
InChI:InChI=1/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4+/s2
InChI key:InChIKey=QXKAIJAYHKCRRA-SMIHLPCKNA-N
SMILES:[C@@H]([C@@H](C(O)=O)O)([C@@H](CO)O)O
Synonyms:- Lyxonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lyxonic acid
CAS:<p>Lyxonic acid is an aldonic acid.</p>Formula:C5H10O6Color and Shape:SolidMolecular weight:166.13
