CAS 28225-88-9
:2,4-Dichloro-5-methylbenzenethiol
Description:
2,4-Dichloro-5-methylbenzenethiol, with the CAS number 28225-88-9, is an organosulfur compound characterized by the presence of a thiol (-SH) group attached to a chlorinated aromatic ring. This compound features two chlorine atoms at the 2 and 4 positions and a methyl group at the 5 position of the benzene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a strong, distinctive odor due to the thiol group. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical syntheses and applications. Additionally, the thiol group can participate in redox reactions and form disulfides, which are important in biological systems. Safety precautions are necessary when handling this compound, as it may be toxic and irritating to the skin and respiratory system. Overall, 2,4-Dichloro-5-methylbenzenethiol is a significant compound in organic chemistry with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H6Cl2S
InChI:InChI=1S/C7H6Cl2S/c1-4-2-7(10)6(9)3-5(4)8/h2-3,10H,1H3
InChI key:InChIKey=SHBIPXMJAAVLGL-UHFFFAOYSA-N
SMILES:CC1=C(Cl)C=C(Cl)C(S)=C1
Synonyms:- 2,4-Dichloro-5-Methylbenzenethiol
- 2,4-Dichloro-5-methylbenzene-1-thiol
- Benzenethiol, 2,4-dichloro-5-methyl-
- m-Toluenethiol, 4,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
