CAS 28230-32-2: 3,4-Dihydro-3-hydroxy-4-oxo-1,2,3-benzotriazine
Description:3,4-Dihydro-3-hydroxy-4-oxo-1,2,3-benzotriazine, with the CAS number 28230-32-2, is a heterocyclic compound characterized by its benzotriazine structure, which includes a fused triazine ring. This compound typically exhibits a range of chemical properties due to the presence of both hydroxyl and carbonyl functional groups, contributing to its reactivity and potential biological activity. It is often studied for its applications in medicinal chemistry, particularly for its potential as an antitumor agent or in other therapeutic contexts. The presence of the hydroxy and keto groups can facilitate hydrogen bonding and influence solubility in various solvents. Additionally, the compound may exhibit UV-Vis absorbance characteristics, making it of interest in photochemical studies. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3,4-Dihydro-3-hydroxy-4-oxo-1,2,3-benzotriazine represents a significant compound in the field of organic and medicinal chemistry.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7-5-3-1-2-4-6(5)8-9-10(7)12/h1-4,12H
InChI key:InChIKey=HJBLUNHMOKFZQX-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=CC2N=NN1O
- Synonyms:
- 1,2,3-Benzotriazin-4(3H)-one, 3-hydroxy-
- 3,4-Dihydro-3-hydroxy-4-oxo-1,2,3-benzotriazine
- 3-Hydroxy-1,2,3-ben zotriazin-4(3H)-one
- 3-Hydroxy-1,2,3-benzotriazin-4-one
- 3-Hydroxy-1,2,3-benzotriazine-4(3H)-one
- 3-Hydroxy-3,4-dihydro-1,2,3-benzotriazin-4-one
- 3-Hydroxy-3,4-dihydro-4-oxo-1,2,3-benzotriazine
- 3-Hydroxy-4-oxo-3,4-dihydro-1,2,3-benzotriazine
- DhbtOH
- HODhbt
- See more synonyms
- Hoobt
- NSC 279266
- 3-Hydroxy-1,2,3-benzotriazin-4(3H)-one

3-Hydroxy-1,2,3-ben zotriazin-4(3H)-one
Ref: IN-DA0038UB
Undefined size | To inquire |

Ref: 54-BUP16873
100mg | 67.00 € | ||
200mg | 94.00 € | ||
500mg | 147.00 € |

HODHBt
Ref: TM-T21267
100mg | 47.00 € | ||
200mg | 60.00 € | ||
500mg | 89.00 € | ||
1mL*10mM (DMSO) | 47.00 € |

3,4-Dihydro-3-Hydroxy-4-Oxo-1,2,3-Benzotriazine (DHOBT, DHBT) extrapure, 98%
Ref: SR-91374
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

3-Hydroxy-3,4-dihydro-1,2,3-benzotriazin-4-one
Ref: 3D-DBA23032
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |