CymitQuimica logo

CAS 28232-63-5

:

3-Bromo-5-phenoxypyridine

Description:
3-Bromo-5-phenoxypyridine is an organic compound characterized by its pyridine ring substituted with a bromine atom at the 3-position and a phenoxy group at the 5-position. This compound typically appears as a solid or liquid, depending on its purity and form. It is known for its role in various chemical reactions and applications, particularly in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. The presence of the bromine atom introduces electrophilic properties, making it a useful building block in organic synthesis. The phenoxy group contributes to the compound's overall stability and can influence its solubility and reactivity. 3-Bromo-5-phenoxypyridine may exhibit biological activity, making it of interest in drug development. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C11H8BrNO
InChI:InChI=1S/C11H8BrNO/c12-9-6-11(8-13-7-9)14-10-4-2-1-3-5-10/h1-8H
InChI key:VIAAKVXECVQWOE-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=CC(=CN=C2)Br
Found 4 products.