CymitQuimica logo

CAS 28232-66-8

:

3-Bromo-5-(4-chlorophenoxy)pyridine

Description:
3-Bromo-5-(4-chlorophenoxy)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 3-position with a bromine atom and at the 5-position with a 4-chlorophenoxy group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of aromatic groups. The bromine and chlorine substituents contribute to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the pyridine moiety suggests potential applications in pharmaceuticals and agrochemicals, as pyridine derivatives are often found in biologically active compounds. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-5-(4-chlorophenoxy)pyridine is a versatile compound with significant implications in synthetic organic chemistry and potential applications in various fields.
Formula:C11H7BrClNO
InChI:InChI=1/C11H7BrClNO/c12-8-5-11(7-14-6-8)15-10-3-1-9(13)2-4-10/h1-7H
SMILES:c1cc(ccc1Cl)Oc1cc(cnc1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.