CAS 28244-98-6
:(3R,5S,6S)-2-(hydroxymethyl)-6-(p-tolylsulfanyl)tetrahydropyran-3,4,5-triol
Description:
The chemical substance known as "(3R,5S,6S)-2-(hydroxymethyl)-6-(p-tolylsulfanyl)tetrahydropyran-3,4,5-triol," with the CAS number 28244-98-6, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl groups, indicating it is a polyol, which contributes to its potential solubility in water and reactivity in various chemical processes. The presence of a p-tolylsulfanyl group suggests that it may exhibit unique properties related to sulfur chemistry, such as potential nucleophilicity or participation in redox reactions. The stereochemistry, denoted by the (3R,5S,6S) configuration, indicates specific spatial arrangements of atoms that can influence the compound's biological activity and interactions with other molecules. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features and functional groups that can participate in various chemical reactions.
Formula:C13H18O5S
InChI:InChI=1/C13H18O5S/c1-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)18-13/h2-5,9-17H,6H2,1H3/t9?,10-,11?,12-,13-/m0/s1
SMILES:Cc1ccc(cc1)S[C@H]1[C@H](C([C@H](C(CO)O1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Methylphenyl β-D-thiogalactopyranoside, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H18O5SPurity:98%Molecular weight:286.344-Methylphenyl 1-thio-β-D-galactopyranoside
CAS:4-Methylphenyl 1-thio-β-D-galactopyranosidePurity:>99%Color and Shape:White SolidMolecular weight:286.34g/mol4-Methylphenylthio-β-D-galactopyranoside
CAS:Controlled ProductFormula:C13H18O5SColor and Shape:NeatMolecular weight:286.344-Methylphenyl β-D-thiogalactopyranoside
CAS:4-Methylphenyl β-D-thiogalactopyranoside is a custom synthesis. The chemical is an Oligosaccharide, Polysaccharide, Modification, saccharide, Methylation, Glycosylation, Carbohydrate that has been Fluorinated and Synthetically Modified. It is a High purity product with the CAS No. 28244-98-6.Formula:C13H18O5SPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:286.35 g/mol






