CymitQuimica logo

CAS 28249-90-3

:

[5-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzo[a]phenoxazin-9-ylidene]-diethyl-ammonium chloride

Description:
The chemical substance known as [5-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzo[a]phenoxazin-9-ylidene]-diethyl-ammonium chloride, with the CAS number 28249-90-3, is a complex organic compound characterized by its unique structural features. It contains a triazine moiety, which is known for its applications in herbicides and other agrochemicals, indicating potential biological activity. The presence of the benzo[a]phenoxazine structure suggests that it may exhibit interesting photophysical properties, possibly making it useful in dye applications or as a fluorescent probe. The diethylammonium group indicates that the compound is quaternary ammonium, which often imparts solubility in polar solvents and can enhance its interaction with biological systems. Additionally, the dichloro substituents may contribute to its reactivity and stability. Overall, this compound's unique combination of functional groups suggests potential applications in fields such as agriculture, materials science, and biochemistry, although specific properties such as solubility, stability, and reactivity would need to be evaluated in detail for practical applications.
Formula:C23H18Cl3N5O2
InChI:InChI=1/C23H18Cl2N5O2.ClH/c1-3-30(4-2)13-9-10-16-18(11-13)31-19-12-17(32-23-28-21(24)27-22(25)29-23)14-7-5-6-8-15(14)20(19)26-16;/h5-12H,3-4H2,1-2H3;1H/q+1;/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.