CAS 2825-00-5
:Aureothin
Description:
Aureothin, with the CAS number 2825-00-5, is a natural product belonging to the class of compounds known as polyketides. It is primarily produced by certain species of the fungus *Penicillium*, and it exhibits a range of biological activities, including antimicrobial and antifungal properties. Aureothin is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its reactivity and biological efficacy. The compound has garnered interest in pharmaceutical research due to its potential applications in treating various infections and diseases. Additionally, its unique chemical properties make it a subject of study in the field of natural product chemistry. As with many natural compounds, the extraction and purification processes can be challenging, and ongoing research aims to explore its mechanisms of action and potential therapeutic uses. Overall, aureothin represents a fascinating example of the diverse chemistry found in nature and its potential applications in medicine.
Formula:C22H23NO6
InChI:InChI=1/C22H23NO6/c1-13(9-16-5-7-18(8-6-16)23(25)26)10-17-11-19(28-12-17)21-14(2)20(24)15(3)22(27-4)29-21/h5-10,19H,11-12H2,1-4H3/b13-9+,17-10-
InChI key:InChIKey=GQKXCBCSVYJUMI-WACKOAQBSA-N
SMILES:CC1=C(OC(OC)=C(C)C1=O)[C@H]2C\C(=C\C(=C\C3=CC=C(N(=O)=O)C=C3)\C)\CO2
Synonyms:- (+)-(R)-Aureothin
- (+)-Aureothin
- (Z,E)-2-Methoxy-3,5-dimethyl-6-[tetrahydro-4-[2-methyl-3-(4-nitrophenyl)-2-propenylidene]-2-furanyl]-4H-pyran-4-one
- 2-Methoxy-3,5-dimethyl-6-[(2R,4Z)-tetrahydro-4-[(2E)-2-methyl-3-(4-nitrophenyl)-2-propen-1-ylidene]-2-furanyl]-4H-pyran-4-one
- 2825-00-5
- 4H-Pyran-4-one, 2-methoxy-3,5-dimethyl-6-[(2R,4Z)-tetrahydro-4-[(2E)-2-methyl-3-(4-nitrophenyl)-2-propen-1-ylidene]-2-furanyl]-
- 4H-Pyran-4-one, 2-methoxy-3,5-dimethyl-6-[(2R,4Z)-tetrahydro-4-[(2E)-2-methyl-3-(4-nitrophenyl)-2-propenylidene]-2-furanyl]-
- 4H-Pyran-4-one, 2-methoxy-3,5-dimethyl-6-[tetrahydro-4-(β-methyl-p-nitrocinnamylidene)-2-furyl]-
- 4H-Pyran-4-one, 2-methoxy-3,5-dimethyl-6-[tetrahydro-4-[2-methyl-3-(4-nitrophenyl)-2-propenylidene]-2-furanyl]-, [R-(Z,E)]-
- 4H-pyran-4-one, 2-methoxy-3,5-dimethyl-6-[(4Z)-tetrahydro-4-[(2E)-2-methyl-3-(4-nitrophenyl)-2-propen-1-ylidene]-2-furanyl]-
- 5-19-06-00099
- Mycolutein
- Strain 58 substance
- 2-Methoxy-3,5-dimethyl-6-{(2R,4Z)-4-[(2E)-2-methyl-3-(4-nitrophenyl)prop-2-en-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one
- 2-[(2R)-4-[(1Z,2E)-2-Methyl-3-(4-nitrophenyl)-2-propenylidene]tetrahydrofuran-2-yl]-3,5-dimethyl-6-methoxy-4H-pyran-4-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Aureothin
CAS:Aureothin: a nitroaryl polyketide with antitumor, antifungal & insecticidal properties; inhibits NADH:oxidoreductase (IC50s: 0.07-22 nmol/mg).Formula:C22H23NO6Color and Shape:SolidMolecular weight:397.42Aureothin
CAS:Formula:C22H23NO6Purity:≥ 98.0%Color and Shape:Off-white to yellow solidMolecular weight:397.4Aureothin
CAS:Aureothin is a bioactive compound, classified as a polyketide antibiotic, which is derived from the culture of the bacterium Streptomyces thioluteus. This compound operates primarily through the inhibition of protein synthesis by interfering with the aminoacylation of tRNA with specific amino acids. Its mode of action disrupts cellular protein synthesis, which is essential for cell growth and function, leading to its potent antibacterial and antifungal activities.Formula:C22H23NO6Purity:Min. 95%Color and Shape:PowderMolecular weight:397.42 g/mol


