CAS 2825-79-8
:(2E)-octadec-2-enoic acid
Description:
(2E)-octadec-2-enoic acid, commonly known as oleic acid, is a monounsaturated fatty acid with a long carbon chain consisting of 18 carbon atoms and one double bond located at the second carbon from the end of the chain. It is a colorless to yellowish oily liquid at room temperature and is insoluble in water but soluble in organic solvents. Oleic acid is characterized by its relatively low melting point compared to saturated fatty acids, which allows it to remain liquid at room temperature. It has a distinctive fatty odor and is known for its emulsifying properties. This fatty acid is widely found in various natural sources, particularly in animal fats and vegetable oils, such as olive oil, where it serves as a major component. Oleic acid plays a significant role in nutrition and health, being associated with various beneficial effects, including potential cardiovascular benefits. Additionally, it is used in the production of soaps, cosmetics, and as a lubricant in industrial applications.
Formula:C18H34O2
InChI:InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/b17-16+
Synonyms:- (11E)-Octadecenoic acid
- (6Z)-Octadecenoic acid
- (9E)-Octadecenoic acid
- (9Z)- Octadecenoic acid
- 10E-octadecenoic acid
- 10Z-octadecenoic acid
- 11Z-Octadecenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2(E)-Octadecenoic acid
CAS:Formula:C18H34O2Purity:>98%Color and Shape:In solution, EthanolMolecular weight:282.46(E)-2-Octadecenoic Acid
CAS:Controlled ProductFormula:C18H34O2Color and Shape:NeatMolecular weight:282.461


