CAS 28250-45-5

(1R,2R)-2-(hydroxymethyl)cyclohexanaminium

Description:

(1R,2R)-2-(hydroxymethyl)cyclohexanaminium, with the CAS number 28250-45-5, is a chiral amine characterized by its cyclohexane ring structure, which features a hydroxymethyl group and an amino group. This compound exhibits basic properties due to the presence of the amine functional group, allowing it to participate in protonation reactions. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements of the substituents, which can influence its reactivity and interactions with biological systems. It is soluble in polar solvents, reflecting the presence of hydroxyl and amine groups that can engage in hydrogen bonding. This compound may have applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of chiral intermediates. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the conditions under which it is studied, including temperature and solvent environment. Overall, (1R,2R)-2-(hydroxymethyl)cyclohexanaminium is notable for its potential utility in various chemical and biological contexts.

Formula: C₇H₁₆NO

InChI: InChI=1/C7H15NO/c8-7-4-2-1-3-6(7)5-9/h6-7,9H,1-5,8H2/p+1/t6-,7+/m0/s1

(Trans-2-aminocyclohexyl)methanol hydrochloride

CAS: 28250-45-5

Formula: C₇H₁₆ClNO

Color and Shape: Solid

Molecular weight: 165.6610

Ref: IN-DA00BE24

rac-[(1R,2R)-2-Aminocyclohexyl]methanol hydrochloride

CAS: 28250-45-5

Versatile small molecule scaffold

Formula: C₇H₁₆ClNO

Purity: Min. 95%

Molecular weight: 165.66 g/mol

Ref: 3D-DBA25045