CAS 28252-82-6

2,4-Dichloro-1,5-naphthyridine

Description:

2,4-Dichloro-1,5-naphthyridine is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms. It features two chlorine substituents at the 2 and 4 positions of the naphthyridine ring system, which contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its molecular structure allows for various chemical reactions, making it of interest in pharmaceutical and agrochemical research. The presence of chlorine atoms enhances its biological activity and can influence its interaction with biological targets. Additionally, 2,4-Dichloro-1,5-naphthyridine may exhibit properties such as antimicrobial or herbicidal activity, depending on its specific application. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound represents a significant class of chemicals with diverse applications in synthetic chemistry and drug development.

Formula: C₈H₄Cl₂N₂

InChI: InChI=1S/C8H4Cl2N2/c9-5-4-7(10)12-6-2-1-3-11-8(5)6/h1-4H

InChI key: InChIKey=BXXUGCOGJVNBKY-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(Cl)C1)C=CC=N2

Synonyms:

• 1,5-Naphthyridine, 2,4-dichloro-
• 2,4-Dichloro-1,5-naphthyridine
• 2,4-Dichloro-1,5-naphthyridine

2,4-dichloro-1,5-naphthyridine

CAS: 28252-82-6

Formula: C₈H₄Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.0368

Ref: IN-DA0032YX

2,4-Dichloro-1,5-naphthyridine

CAS: 28252-82-6

2,4-Dichloro-1,5-naphthyridine

Purity: 95%

Molecular weight: 199.04g/mol

Ref: 54-OR55302

2,4-Dichloro-1,5-naphthyridine

CAS: 28252-82-6

Purity: 98%

Molecular weight: 199.0299988

Ref: 10-F780110

2,4-dichloro-1,5-naphthyridine

CAS: 28252-82-6

2,4-Dichloro-1,5-naphthyridine is a methanolic solution of hydrogen chloride and chloroquine. It has been shown to be an effective antimalarial agent. 2,4-Dichloro-1,5-naphthyridine has been synthesized by the reaction of methanolic hydrogen chloride and sodium methoxide with 1,5-dichloronaphthalene in the presence of chloroform. The chemical name for this compound is 2-(2′,4′-dichlorophenyl)-1H-isoindole-1,3(2H)-dione. This chemical has not been studied extensively in humans but it is thought that it may have similar effects to primaquine.

Formula: C₈H₄Cl₂N₂

Purity: Min. 95%

Molecular weight: 199 g/mol

Ref: 3D-DBA25282