
CAS 282523-42-6
:2-(4-Chlorophenyl)-1-[(4-chlorophenyl)methoxy]-6-nitro-1H-benzimidazole
Description:
2-(4-Chlorophenyl)-1-[(4-chlorophenyl)methoxy]-6-nitro-1H-benzimidazole is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with various functional groups. The presence of two chlorophenyl groups and a nitro group contributes to its potential biological activity and lipophilicity. The compound is likely to exhibit moderate to high stability under standard conditions, although specific stability data would depend on environmental factors such as temperature and pH. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The nitro group may also influence its reactivity and solubility properties. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, with implications for medicinal chemistry and drug development.
Formula:C20H13Cl2N3O3
InChI:InChI=1S/C20H13Cl2N3O3/c21-15-5-1-13(2-6-15)12-28-24-19-11-17(25(26)27)9-10-18(19)23-20(24)14-3-7-16(22)8-4-14/h1-11H,12H2
InChI key:InChIKey=RCFHYKYZDFIACM-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(Cl)C=C1)N2C=3C(N=C2C4=CC=C(Cl)C=C4)=CC=C(N(=O)=O)C3
Synonyms:- 2-(4-Chlorophenyl)-1-[(4-chlorophenyl)methoxy]-6-nitro-1H-benzimidazole
- 1H-Benzimidazole, 2-(4-chlorophenyl)-1-[(4-chlorophenyl)methoxy]-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.