CAS 282524-94-1
:3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanoic acid
Description:
3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanoic acid, commonly referred to as Fmoc-hexanoic acid, is a chemical compound characterized by its structure, which includes a hexanoic acid backbone and an Fmoc (9-fluorenylmethoxycarbonyl) protecting group. This compound is primarily used in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with other functional groups. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in synthetic chemistry. The presence of the hexanoic acid moiety contributes to the hydrophobic character of the molecule, influencing its solubility and interaction with other compounds. Additionally, the compound's molecular structure allows for potential applications in drug development and bioconjugation strategies. Overall, Fmoc-hexanoic acid is a valuable tool in organic synthesis and biochemistry, facilitating the construction of complex peptide sequences.
Formula:C21H23NO4
InChI:InChI=1S/C21H23NO4/c1-2-7-14(12-20(23)24)22-21(25)26-13-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,14,19H,2,7,12-13H2,1H3,(H,22,25)(H,23,24)
InChI key:InChIKey=VQAFHGLNHSVMSP-UHFFFAOYSA-N
SMILES:C(OC(NC(CC(O)=O)CCC)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- Hexanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
- 3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.