CAS 2827-21-6
:Pregn-4-ene-3,20-dione, 21-(acetyloxy)-11,18-epoxy-18-hydroxy-, (11β)-
Description:
Pregn-4-ene-3,20-dione, 21-(acetyloxy)-11,18-epoxy-18-hydroxy-, (11β)-, commonly known as a synthetic steroid, exhibits several notable characteristics. This compound is a derivative of progesterone, featuring modifications that enhance its biological activity and stability. The presence of an acetyloxy group at the 21 position and an epoxy group at the 11,18 positions contributes to its unique pharmacological properties. It is typically used in medicinal chemistry and pharmacology for its potential applications in hormone replacement therapy and as an anti-inflammatory agent. The structural modifications also influence its solubility, receptor binding affinity, and metabolic stability. As a steroid, it shares common characteristics with other steroid hormones, such as a four-ring carbon structure, which is crucial for its biological function. The compound's CAS number, 2827-21-6, allows for easy identification and reference in scientific literature and databases. Overall, this compound represents a significant interest in the field of synthetic steroids and their therapeutic uses.
Formula:C23H30O6
InChI:InChI=1S/C23H30O6/c1-12(24)28-11-18(26)17-6-5-16-15-4-3-13-9-14(25)7-8-22(13,2)20(15)19-10-23(16,17)21(27)29-19/h9,15-17,19-21,27H,3-8,10-11H2,1-2H3/t15-,16-,17+,19-,20+,21?,22-,23+/m0/s1
InChI key:InChIKey=JUHQUIOIVOVZQG-XNEAOMTKSA-N
SMILES:C(COC(C)=O)(=O)[C@@H]1[C@]23[C@]([C@]4([C@]([C@](C2)(OC3O)[H])([C@]5(C)C(CC4)=CC(=O)CC5)[H])[H])(CC1)[H]
Synonyms:- Pregn-4-ene-3,20-dione, 21-(acetyloxy)-11,18-epoxy-18-hydroxy-, (11β)-
- 11,13-(Epoxymethano)-13H-cyclopenta[a]phenanthrene, pregn-4-ene-3,20-dione deriv.
- Aldosterone, 21-acetate
- Aldosterone 21-monoacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Aldosterone 21-Acetate
CAS:Controlled ProductApplications Aldosterone (A514700) derivative.
References Harnik, M. et al.: Steroids 54, 11 (1989)Formula:C23H30O6Color and Shape:NeatMolecular weight:402.48
