CAS 2827-44-3
:6-ethoxy-1,3,5-triazine-2,4-diamine
Description:
6-Ethoxy-1,3,5-triazine-2,4-diamine, with the CAS number 2827-44-3, is an organic compound characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This substance features ethoxy and amino functional groups, contributing to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. The presence of the ethoxy group enhances its solubility in organic solvents, while the amino groups can participate in hydrogen bonding and nucleophilic reactions. Typically, compounds of this nature exhibit moderate stability under standard conditions but may undergo hydrolysis or other transformations in the presence of strong acids or bases. Its unique structure allows for potential use as a building block in the synthesis of more complex molecules or as a herbicide or pesticide due to its biological activity. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C5H9N5O
InChI:InChI=1/C5H9N5O/c1-2-11-5-9-3(6)8-4(7)10-5/h2H2,1H3,(H4,6,7,8,9,10)
SMILES:CCOc1nc(=N)[nH]c(=N)[nH]1
Synonyms:- 1,3,5-Triazine-2,4-Diamine, 6-Ethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,4-Diamino-6-ethoxytriazine
CAS:2,4-Diamino-6-ethoxytriazine is a fine chemical that can be used as a building block in the synthesis of various organic compounds. The compound has been shown to react with other chemicals to form new compounds. 2,4-Diamino-6-ethoxytriazine is also used as a reagent and speciality chemical in research laboratories and as a reaction component or useful intermediate in the synthesis of various organic compounds. 2,4-Diamino-6-ethoxytriazine is versatile enough to serve as a scaffold for more complex molecules.
Formula:C5H9N5OPurity:Min. 95%Color and Shape:SolidMolecular weight:155.16 g/mol
