CAS 282727-21-3

(2,6-Dimethylphenyl)iodozinc

Description:

(2,6-Dimethylphenyl)iodozinc, with the CAS number 282727-21-3, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo group and a 2,6-dimethylphenyl group. This compound typically exhibits properties associated with organometallic compounds, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis. The presence of the iodo group enhances its reactivity, allowing it to participate in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. The 2,6-dimethylphenyl moiety contributes to the compound's steric and electronic properties, influencing its reactivity and stability. Generally, organozinc compounds are known for their ability to act as nucleophiles in reactions, and (2,6-Dimethylphenyl)iodozinc is no exception, making it a useful reagent in the synthesis of complex organic molecules. Safety precautions should be observed when handling this compound, as organozinc reagents can be sensitive to moisture and air.

Formula: C₈H₉IZn

InChI: InChI=1S/C8H9.HI.Zn/c1-7-4-3-5-8(2)6-7;;/h3-5H,1-2H3;1H;/q;;+1/p-1

InChI key: InChIKey=GTMHBPQJIFBGRR-UHFFFAOYSA-M

SMILES: [Zn](I)C1=C(C)C=CC=C1C

Synonyms:

• (2,6-Dimethylphenyl)iodozinc
• Zinc, (2,6-dimethylphenyl)iodo-