CymitQuimica logo

CAS 282734-33-2

:

L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-iodo-,1,1-dimethylethyl ester

Description:
L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-iodo-, 1,1-dimethylethyl ester, commonly referred to as a protected amino acid derivative, is characterized by its complex structure that includes an alanine backbone modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group and an iodine substituent at the 3-position. This compound is typically used in peptide synthesis, where the Fmoc group serves as a temporary protective group for the amino group, facilitating the stepwise assembly of peptides. The presence of the iodine atom can enhance the reactivity of the compound in certain chemical reactions, making it useful in various synthetic applications. Additionally, the tert-butyl ester group contributes to the compound's solubility and stability, allowing for easier handling during synthesis. Overall, this compound is significant in the field of organic chemistry and biochemistry, particularly in the development of peptide-based therapeutics and research applications. Its unique structural features make it a valuable tool for chemists working in peptide synthesis and modification.
Formula:C22H24INO4
InChI:InChI=1S/C22H24INO4/c1-22(2,3)28-20(25)19(12-23)24-21(26)27-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,26)/t19-/m0/s1
InChI key:WFECRYMZJXNQQC-IBGZPJMESA-N
SMILES:CC(C)(C)OC(=O)[C@H](CI)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Found 5 products.