CAS 282735-66-4

(5R,6S)-5,6-Diphenyl-2-morpholinone

Description:

(5R,6S)-5,6-Diphenyl-2-morpholinone is a chemical compound characterized by its morpholinone structure, which includes a morpholine ring and two phenyl groups attached to the 5 and 6 positions of the ring. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may influence biological activity. The presence of the morpholine moiety can enhance solubility and bioavailability, making it a candidate for drug development. Additionally, the stereochemistry indicated by the (5R,6S) configuration suggests specific spatial arrangements that can significantly affect the compound's interactions with biological targets. Its CAS number, 282735-66-4, allows for easy identification in chemical databases. Overall, (5R,6S)-5,6-Diphenyl-2-morpholinone is of interest in research contexts, particularly in the development of pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₆H₁₅NO₂

InChI: InChI=1/C16H15NO2/c18-14-11-17-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-10,15-17H,11H2/t15-,16+/m1/s1

Synonyms:

• (5R,6S)-5,6-Diphenylmorpholin-2-one
• ((5R,6S)-2,3,5,6-tetrahydro-5,6- diphenyl-1,4-oxazin

(5R,6S)-5,6-Diphenyl-2-Morpholinone

CAS: 282735-66-4

Formula: C₁₆H₁₅NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 253.2958

Ref: IN-DA003BYE

(5R,6S)-5,6-Diphenyl-2-Morpholinone

CAS: 282735-66-4

(5R,6S)-5,6-Diphenyl-2-Morpholinone

Purity: 96%

Molecular weight: 253.30g/mol

Ref: 54-OR1008287

(5R,6S)-5,6-Diphenyl-2-morpholinone

CAS: 282735-66-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 253.30099487304688

Ref: 10-F077247