CAS 28286-79-5
:3-(hydroxymethyl)benzoic acid
Description:
3-(Hydroxymethyl)benzoic acid, also known as 3-(hydroxymethyl)benzenecarboxylic acid, is an aromatic carboxylic acid characterized by the presence of a hydroxymethyl group (-CH2OH) and a carboxylic acid group (-COOH) attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to its ability to form hydrogen bonds. The presence of both functional groups contributes to its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and organic synthesis. Its molecular structure allows for potential interactions in biological systems, which may lead to various biological activities. Additionally, 3-(hydroxymethyl)benzoic acid can serve as a building block in the synthesis of more complex molecules, highlighting its importance in organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H8O3
InChI:InChI=1/C8H8O3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2,(H,10,11)
SMILES:c1cc(cc(c1)C(=O)O)CO
Synonyms:- Benzoic Acid, 3-(Hydroxymethyl)-
- 3-Methylolbenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(HYDROXYMETHYL)-BENZOIC ACID
CAS:Formula:C8H8O3Purity:95%Color and Shape:SolidMolecular weight:152.14733-(Hydroxymethyl)benzoic acid
CAS:3-(Hydroxymethyl)benzoic acidFormula:C8H8O3Purity:98%Color and Shape: white powderMolecular weight:152.15g/mol3-(Hydroxymethyl)benzoic acid
CAS:3-(Hydroxymethyl)benzoic acid is a versatile building block that can be used in the synthesis of a wide range of compounds. It is an important intermediate in the synthesis of pharmaceuticals and agrochemicals. 3-(Hydroxymethyl)benzoic acid is also used as a reagent for organic synthesis, and as a speciality chemical and research chemicals. This compound has many uses, including as a building block for complex compounds, as a reaction component for the preparation of other useful compounds, and as a scaffold for diverse synthetic applications.Formula:C8H8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol3-(Hydroxymethyl)benzoic acid
CAS:Formula:C8H8O3Purity:95%Color and Shape:SolidMolecular weight:152.149



