CAS 28286-79-5

3-(hydroxymethyl)benzoic acid

Description:

3-(Hydroxymethyl)benzoic acid, also known as 3-(hydroxymethyl)benzenecarboxylic acid, is an aromatic carboxylic acid characterized by the presence of a hydroxymethyl group (-CH2OH) and a carboxylic acid group (-COOH) attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to its ability to form hydrogen bonds. The presence of both functional groups contributes to its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and organic synthesis. Its molecular structure allows for potential interactions in biological systems, which may lead to various biological activities. Additionally, 3-(hydroxymethyl)benzoic acid can serve as a building block in the synthesis of more complex molecules, highlighting its importance in organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₈O₃

InChI: InChI=1/C8H8O3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2,(H,10,11)

SMILES: c1cc(cc(c1)C(=O)O)CO

Synonyms:

• Benzoic Acid, 3-(Hydroxymethyl)-
• 3-Methylolbenzoic Acid

3-(HYDROXYMETHYL)-BENZOIC ACID

CAS: 28286-79-5

Formula: C₈H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 152.1473

Ref: IN-DA00BCAA

3-(Hydroxymethyl)benzoic acid

CAS: 28286-79-5

3-(Hydroxymethyl)benzoic acid

Formula: C₈H₈O₃

Purity: 98%

Color and Shape: white powder

Molecular weight: 152.15g/mol

Ref: 54-OR345068

3-(Hydroxymethyl)benzoic acid

CAS: 28286-79-5

3-(Hydroxymethyl)benzoic acid is a versatile building block that can be used in the synthesis of a wide range of compounds. It is an important intermediate in the synthesis of pharmaceuticals and agrochemicals. 3-(Hydroxymethyl)benzoic acid is also used as a reagent for organic synthesis, and as a speciality chemical and research chemicals. This compound has many uses, including as a building block for complex compounds, as a reaction component for the preparation of other useful compounds, and as a scaffold for diverse synthetic applications.

Formula: C₈H₈O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 152.15 g/mol

Ref: 3D-FH55587

3-(Hydroxymethyl)benzoic acid

CAS: 28286-79-5

Formula: C₈H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 152.149

Ref: 10-F233358