CAS 28290-41-7

trans,trans-farnesyl bromide

Description:

Trans,trans-farnesyl bromide is an organic compound characterized by its structure, which includes a farnesyl group—a branched-chain hydrocarbon with multiple double bonds—attached to a bromine atom. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of the bromine atom, which can participate in various chemical reactions, including nucleophilic substitutions. It is often used in organic synthesis and as an intermediate in the production of more complex molecules. The compound is soluble in organic solvents but has limited solubility in water, reflecting its hydrophobic nature. Additionally, trans,trans-farnesyl bromide may exhibit biological activity, making it of interest in medicinal chemistry and biochemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used to mitigate exposure.

Formula: C₁₅H₂₅Br

InChI: InChI=1/C15H25Br/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+

Synonyms:

• (2E,6E)-1-bromo-3,7,11-trimethyldodeca-2,6,10-triene

TRANS,TRANS-FARNESYL BROMIDE

CAS: 28290-41-7

Formula: C₁₅H₂₅Br

Purity: 95%

Color and Shape: Liquid

Molecular weight: 285.2630

Ref: IN-DA003C11

(E,E)-Farnesyl Bromide

Controlled Product

CAS: 28290-41-7

Formula: C₁₅H₂₅Br

Color and Shape: Neat

Molecular weight: 285.26

Ref: TR-F102440

FARNESYL BROMIDE

CAS: 28290-41-7

Formula: C₁₅H₂₅Br

Purity: 95.0%

Molecular weight: 285.269

Ref: 10-F472666

(E,E)-Farnesyl-13C3 Bromide

Controlled Product

CAS: 28290-41-7

Formula: C₃C₁₂H₂₅Br

Color and Shape: Neat

Molecular weight: 288.241

Ref: TR-F102442