CAS 28291-73-8

N-(butan-2-yl)-1,3-benzothiazol-2-amine

Description:

N-(butan-2-yl)-1,3-benzothiazol-2-amine, with the CAS number 28291-73-8, is an organic compound characterized by its benzothiazole core, which is a bicyclic structure containing both a benzene ring and a thiazole ring. This compound features a butan-2-yl substituent at the nitrogen atom of the amine group, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amine group suggests potential basicity and reactivity, particularly in forming salts or engaging in nucleophilic reactions. Additionally, the benzothiazole moiety is known for its applications in pharmaceuticals and agrochemicals, often exhibiting biological activity. Safety data should be consulted for handling, as compounds of this nature may pose health risks if inhaled, ingested, or in contact with skin. Overall, N-(butan-2-yl)-1,3-benzothiazol-2-amine is a compound of interest in various chemical research and industrial applications.

Formula: C₁₁H₁₄N₂S

InChI: InChI=1/C11H14N2S/c1-3-8(2)12-11-13-9-6-4-5-7-10(9)14-11/h4-8H,3H2,1-2H3,(H,12,13)

SMILES: CCC(C)N=c1[nH]c2ccccc2s1

Synonyms:

• N-[(2R)-butan-2-yl]-1,3-benzothiazol-2-amine
• N-[(2S)-butan-2-yl]-1,3-benzothiazol-2-amine

N-(Butan-2-yl)-1,3-benzothiazol-2-amine

CAS: 28291-73-8

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂S

Purity: Min. 95%

Molecular weight: 206.31 g/mol

Ref: 3D-DBA29173