CAS 283-60-3

Silatrane

Description:

Silatrane, with the CAS number 283-60-3, is a chemical compound characterized by its unique silatrane structure, which features a silicon atom bonded to nitrogen and oxygen atoms. This compound typically exhibits a five-membered ring structure, incorporating both silicon and nitrogen, which contributes to its stability and reactivity. Silatrane is known for its potential applications in various fields, including materials science and organic synthesis, due to its ability to form stable complexes and its reactivity towards nucleophiles. It is often utilized as a precursor in the synthesis of silicon-containing polymers and as a building block in the development of functional materials. Additionally, silatrane can exhibit interesting properties such as thermal stability and resistance to moisture, making it valuable in specific industrial applications. Its unique chemical properties stem from the presence of the silicon-nitrogen bond, which influences its behavior in chemical reactions and interactions with other substances.

Formula: C₆H₁₃NO₃Si

InChI: InChI=1S/C6H13NO3Si/c1-4-8-11-9-5-2-7(1)3-6-10-11/h11H,1-6H2

InChI key: InChIKey=PZRZYNDNPQRQRN-UHFFFAOYSA-N

SMILES: N12CCO[SiH](OCC1)OCC2

Synonyms:

• NSC 626544
• Silatrane
• 2,8,9-Trioxa-5-aza-1-silabicyclo[3.3.3]undecane

Silatrane

Controlled Product

CAS: 283-60-3

Applications Silatrane can be used as a reversible cholinesterase inhibitor. Silatrane and its derivatives can also be used as antitumor agents.
References Rozengart, E., et al.: Khimiko-Farmatsevticheskii Zhurnal, 23, 170  (1989); Grna, A., et al.: Anticancer Res., 8, 249 (1988)

Formula: C₆H₁₃NO₃Si

Color and Shape: Neat

Molecular weight: 175.26

Ref: TR-S433000

Silatrane

CAS: 283-60-3

Silatrane is a reversible cholinesterase inhibitor and anti-tumor agent.

Formula: C₆H₁₃NO₃Si

Color and Shape: Solid

Molecular weight: 175.26

Ref: TM-T69507