CAS 283-60-3
:Silatrane
Description:
Silatrane, with the CAS number 283-60-3, is a chemical compound characterized by its unique silatrane structure, which features a silicon atom bonded to nitrogen and oxygen atoms. This compound typically exhibits a five-membered ring structure, incorporating both silicon and nitrogen, which contributes to its stability and reactivity. Silatrane is known for its potential applications in various fields, including materials science and organic synthesis, due to its ability to form stable complexes and its reactivity towards nucleophiles. It is often utilized as a precursor in the synthesis of silicon-containing polymers and as a building block in the development of functional materials. Additionally, silatrane can exhibit interesting properties such as thermal stability and resistance to moisture, making it valuable in specific industrial applications. Its unique chemical properties stem from the presence of the silicon-nitrogen bond, which influences its behavior in chemical reactions and interactions with other substances.
Formula:C6H13NO3Si
InChI:InChI=1S/C6H13NO3Si/c1-4-8-11-9-5-2-7(1)3-6-10-11/h11H,1-6H2
InChI key:InChIKey=PZRZYNDNPQRQRN-UHFFFAOYSA-N
SMILES:N12CCO[SiH](OCC1)OCC2
Synonyms:- NSC 626544
- Silatrane
- 2,8,9-Trioxa-5-aza-1-silabicyclo[3.3.3]undecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Silatrane
CAS:Controlled ProductApplications Silatrane can be used as a reversible cholinesterase inhibitor. Silatrane and its derivatives can also be used as antitumor agents.
References Rozengart, E., et al.: Khimiko-Farmatsevticheskii Zhurnal, 23, 170 (1989); Grna, A., et al.: Anticancer Res., 8, 249 (1988)Formula:C6H13NO3SiColor and Shape:NeatMolecular weight:175.26Silatrane
CAS:Silatrane is a reversible cholinesterase inhibitor and anti-tumor agent.Formula:C6H13NO3SiColor and Shape:SolidMolecular weight:175.26

