CAS 28309-44-6

N-hydroxytricyclo[3.3.1.1~3,7~]decane-1-carboxamide

Description:

N-hydroxytricyclo[3.3.1.1^3,7]decane-1-carboxamide, with the CAS number 28309-44-6, is a chemical compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. This compound features a hydroxylamine functional group (-NHOH) and a carboxamide group (-C(=O)NH2), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the hydroxylamine group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or oxidation processes. Additionally, the tricyclic framework can influence the compound's physical properties, such as solubility and stability, making it of interest in the development of pharmaceuticals or agrochemicals. Its specific stereochemistry and spatial arrangement can also affect its biological activity and interactions with other molecules. Overall, N-hydroxytricyclo[3.3.1.1^3,7]decane-1-carboxamide represents a complex organic structure with potential utility in various chemical applications.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c13-10(12-14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9,14H,1-6H2,(H,12,13)

SMILES: C1C2CC3CC1CC(C2)(C3)C(=NO)O

Synonyms:

• N-Hydroxyadamantane-1-carboxamide
• tricyclo[3.3.1.1~3,7~]decane-1-carboxamide, N-hydroxy-

N-Hydroxyadamantane-1-carboxamide

CAS: 28309-44-6

N-Hydroxyadamantane-1-carboxamide is a research chemical that acts as a growth factor and has various applications in the field of medicine and biology. It has been shown to inhibit tumor necrosis factor-alpha (TNF-α), which plays a role in inflammation and immune response. Additionally, N-Hydroxyadamantane-1-carboxamide can be used as an electrode inhibitor in electrochemical studies.

Formula: C₁₁H₁₇NO₂

Purity: Min. 95%

Molecular weight: 195.26 g/mol

Ref: 3D-DBA30944