CAS 28314-81-0

3-Bromo-2,6-difluorobenzoic acid

Description:

3-Bromo-2,6-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, specifically at the 3 and 2,6 positions, respectively. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The presence of halogen substituents, such as bromine and fluorine, can significantly influence the compound's reactivity, polarity, and solubility in various solvents. Typically, halogenated benzoic acids exhibit enhanced biological activity and can serve as intermediates in the synthesis of pharmaceuticals and agrochemicals. The molecular structure of 3-Bromo-2,6-difluorobenzoic acid allows for potential applications in organic synthesis, particularly in the development of more complex molecules. Additionally, the compound's unique electronic properties, due to the electronegative halogens, may affect its interactions in chemical reactions, making it a subject of interest in both academic and industrial research.

Formula: C₇H₃BrF₂O₂

InChI: InChI=1S/C7H3BrF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12)

InChI key: InChIKey=WEBVJSPIUIPJKV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C(Br)=CC=C1F

Synonyms:

• Benzoic acid, 3-bromo-2,6-difluoro-
• 3-Bromo-2,6-difluorobenzoic acid

3-Bromo-2,6-difluorobenzoic acid

CAS: 28314-81-0

Formula: C₇H₃BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.9983

Ref: IN-DA00BFEZ

3-Bromo-2,6-difluorobenzoic acid

CAS: 28314-81-0

3-Bromo-2,6-difluorobenzoic acid

Formula: C₇H₃BrF₂O₂

Purity: 96%

Color and Shape: pale yellow solid

Molecular weight: 237.00g/mol

Ref: 54-PC49617

3-Bromo-2,6-difluorobenzoic acid

CAS: 28314-81-0

Formula: C₇H₃BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 237

Ref: 10-F037595