CAS 28314-82-1
:Benzoic acid, 4-bromo-2,5-difluoro-
Description:
4-Bromo-2,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure with specific halogen substitutions. The compound features a bromine atom at the para position and two fluorine atoms at the ortho positions relative to the carboxylic acid group on the benzene ring. This substitution pattern influences its chemical properties, including its acidity and reactivity. The presence of electronegative halogens typically enhances the acidity of the carboxylic acid due to their electron-withdrawing effects, which stabilize the carboxylate ion formed upon deprotonation. Additionally, the compound may exhibit unique solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular structure can lead to interesting interactions in various chemical reactions, making it a valuable compound in organic synthesis and materials science. Furthermore, the compound's specific properties can be influenced by factors such as temperature and the presence of other functional groups in a reaction environment.
Formula:C7H3BrF2O2
InChI:InChI=1S/C7H3BrF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12)
InChI key:InChIKey=YWZSTHLOAZTDFJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=C(Br)C(F)=C1
Synonyms:- 4-Bromo-2,5-difluorobenzoic acid
- Benzoic acid, 4-bromo-2,5-difluoro-
- 4-bromo-2,5-difluorobenzoic acid ISO 9001:2015 REACH
- 2,5-Difluoro-4-broMobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-2,5-difluorobenzoic acid
CAS:Formula:C7H3BrF2O2Purity:98%Color and Shape:SolidMolecular weight:236.9983Ref: IN-DA00C3W5
1kgTo inquire500gTo inquire250mg20.00€1g25.00€5g31.00€10g53.00€25g81.00€50g122.00€100g171.00€4-bromo-2,5-difluorobenzoic acid, min. 98%
CAS:Formula:C7H3BrF2O2Purity:min. 98%Color and Shape:White to off white solidMolecular weight:237.004-Bromo-2,5-difluorobenzoic acid
CAS:4-Bromo-2,5-difluorobenzoic acidFormula:C7H3BrF2O2Purity:97%Color and Shape: white solidMolecular weight:237.00g/mol4-Bromo-2,5-difluorobenzoic acid
CAS:Formula:C7H3BrF2O2Purity:95%Color and Shape:SolidMolecular weight:2374-bromo-2,5-difluorobenzoic Acid
CAS:4-Bromo-2,5-difluorobenzoic acid is a potent inhibitor of isoforms CYP2C9 and CYP2D6. It is an acidic drug with a pKa of 3.8, which makes it ionizable in biological fluids. 4-Bromo-2,5-difluorobenzoic acid inhibits the activity of CYP2C9 and CYP2D6 by binding to the pharmacophore region of these enzymes. 4-Bromo-2,5-difluorobenzoic acid also has an isosteric functionality that increases its selectivity for CYP2C9 and CYP2D6 over other cytochrome P450 isoforms. The functional groups on 4-bromo-2,5-difluorobenzoic acid are part of the inhibitor's nature that make it selective for these two cytochromeFormula:C7H3BrF2O2Purity:Min. 95%Molecular weight:237 g/mol4-bromo-2,5-difluorobenzoic acid
CAS:Formula:C7H3BrF2O2Purity:98.0 min. %Color and Shape:White to off white solidMolecular weight:237





