CAS 28314-82-1: Benzoic acid, 4-bromo-2,5-difluoro-

Description:4-Bromo-2,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure with specific halogen substitutions. The compound features a bromine atom at the para position and two fluorine atoms at the ortho positions relative to the carboxylic acid group on the benzene ring. This substitution pattern influences its chemical properties, including its acidity and reactivity. The presence of electronegative halogens typically enhances the acidity of the carboxylic acid due to their electron-withdrawing effects, which stabilize the carboxylate ion formed upon deprotonation. Additionally, the compound may exhibit unique solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular structure can lead to interesting interactions in various chemical reactions, making it a valuable compound in organic synthesis and materials science. Furthermore, the compound's specific properties can be influenced by factors such as temperature and the presence of other functional groups in a reaction environment.

Formula:C₇H₃BrF₂O₂

InChI:InChI=1S/C7H3BrF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12)

InChI key:InChIKey=YWZSTHLOAZTDFJ-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(F)C(Br)=CC1F

Synonyms:
4-Bromo-2,5-difluorobenzoic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-bromo-2,5-difluorobenzoic acid REF: IN-DA00C3W5CAS: 28314-82-1	97%	To inquire	Wed 16 Apr 25
4-bromo-2,5-difluorobenzoic acid REF: 08-B1064CAS: 28314-82-1	98.0 min. %	To inquire	Thu 17 Apr 25
4-Bromo-2,5-difluorobenzoic acid REF: 54-PC501855CAS: 28314-82-1	97%	32.00 €~156.00 €	Wed 23 Apr 25
4-Bromo-2,5-difluorobenzoic acid REF: 10-F069428CAS: 28314-82-1	95.0%	To inquire	Mon 28 Apr 25
4-bromo-2,5-difluorobenzoic Acid REF: 3D-FB105797CAS: 28314-82-1	Min. 95%	To inquire	Wed 28 May 25