CAS 28320-31-2
:2-Bromo-9,9-dimethylfluorene
Description:
2-Bromo-9,9-dimethylfluorene is an organic compound characterized by its structure, which includes a fluorene backbone substituted with a bromine atom and two methyl groups at the 9-position. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the fluorene moiety. The bromine substitution introduces a halogen, which can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the dimethyl groups enhances its steric bulk, which can affect its solubility and interaction with other molecules. 2-Bromo-9,9-dimethylfluorene is often utilized in organic synthesis and materials science, particularly in the development of organic semiconductors and dyes. Its unique structural features contribute to its potential applications in research and industry, particularly in the fields of organic electronics and photonics. Safety precautions should be observed when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.
Formula:C15H13Br
InChI:InChI=1/C15H13Br/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15/h3-9H,1-2H3
SMILES:CC1(C)c2ccccc2c2ccc(cc12)Br
Synonyms:- 2-bromo-9,9-dimethyl-9H-fluorene
- 9,9-Dimethyl-2-bromofluorene
- 9,9-Dimethyl-2-bromofluorenone
- 2-Bromo-9,9-dimethy1-9H-fluorene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromo-9,9-dimethylfluorene
CAS:Formula:C15H13BrPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:273.172-Bromo-9,9-dimethylfluorene, 98%
CAS:This material is a popular synthetic precursor for OLED materials. Also used to make devices that efficiently emit a deep blue color. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legaFormula:C15H13BrPurity:98%Molecular weight:273.172-Bromo-9,9-dimethylfluorene
CAS:Formula:C15H13BrPurity:98%Color and Shape:SolidMolecular weight:273.16772-Bromo-9,9-dimethyl-9H-fluorene
CAS:2-Bromo-9,9-dimethyl-9H-fluoreneFormula:C15H13BrPurity:97%Color and Shape: white crystalline powderMolecular weight:273.17g/mol9,9-Dimethyl-2-bromofluorene
CAS:Formula:C15H13BrPurity:95%Color and Shape:SolidMolecular weight:273.173






