CAS 28321-49-5
:5-aminobenzene-1,3-dicarboxamide
Description:
5-Aminobenzene-1,3-dicarboxamide, also known as 5-aminophthalic acid diamide, is an organic compound characterized by the presence of two carboxamide groups attached to a benzene ring that also features an amino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of both amino and carboxamide functional groups contributes to its potential as a building block in organic synthesis and materials science. It may exhibit properties such as moderate thermal stability and can participate in various chemical reactions, including amide bond formation and nucleophilic substitutions. Additionally, its structural features may impart biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 5-aminobenzene-1,3-dicarboxamide is a versatile compound with applications in various fields, including organic chemistry and materials development.
Formula:C8H9N3O2
InChI:InChI=1/C8H9N3O2/c9-6-2-4(7(10)12)1-5(3-6)8(11)13/h1-3H,9H2,(H2,10,12)(H2,11,13)
SMILES:c1c(cc(cc1C(=N)O)N)C(=N)O
Synonyms:- 1,3-Benzenedicarboxamide, 5-Amino-
- 5-Aminoisophthalamide
- 5-Amino-isophthalamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Amino-isophthalamide
CAS:5-Amino-isophthalamide (5AIP) is a molecule that can be used as a molecular probe for the reticulum. It has been shown to inhibit protein synthesis in vivo and in vitro. 5AIP binds to the 30S ribosomal subunit, preventing the binding of aminoacyl-tRNA and peptidyl-tRNA to the acceptor site on the ribosome. This prevents the formation of a peptide bond between two amino acids, which is required for protein synthesis. The binding of 5AIP to the 30S ribosomal subunit also inhibits translation by preventing peptidyltransferase from transferring tRNA from its A site to P site. In addition, 5AIP binds to lanthanide ions such as terbium and europium, which can be used in diagnostic techniques such as fluorescence spectroscopy or magnetic resonance imaging. 5AIP is also an amide with one chiral carbonFormula:C8H9N3O2Purity:Min. 95%Molecular weight:179.18 g/mol
