CAS 28328-53-2
:3-(Aminosulfonyl)-5-nitro-4-phenoxybenzoic acid
Description:
3-(Aminosulfonyl)-5-nitro-4-phenoxybenzoic acid, with the CAS number 28328-53-2, is a chemical compound that features a complex structure characterized by the presence of a benzoic acid moiety substituted with a nitro group, a phenoxy group, and an aminosulfonyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the sulfonamide functional group. The nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and interaction with biological systems. The phenoxy group may enhance lipophilicity, affecting its distribution in biological environments. This compound may also exhibit biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, particularly in the development of anti-inflammatory or antimicrobial agents. Its specific applications and behavior in chemical reactions would depend on the functional groups present and their interactions with other molecules. Safety data and handling precautions should be considered due to the presence of potentially hazardous functional groups.
Formula:C13H10N2O7S
InChI:InChI=1S/C13H10N2O7S/c14-23(20,21)11-7-8(13(16)17)6-10(15(18)19)12(11)22-9-4-2-1-3-5-9/h1-7H,(H,16,17)(H2,14,20,21)
InChI key:InChIKey=NXJUSSNAIUIVKY-UHFFFAOYSA-N
SMILES:O(C1=C(S(N)(=O)=O)C=C(C(O)=O)C=C1N(=O)=O)C2=CC=CC=C2
Synonyms:- 3-(Aminosulfonyl)-5-nitro-4-phenoxybenzoic acid
- 3-Nitro-4-Phenoxy-5-Sulfamoylbenzoic Acid
- Benzoic acid, 3-(aminosulfonyl)-5-nitro-4-phenoxy-
- Benzoic acid, 3-nitro-4-phenoxy-5-sulfamoyl-
- 3-Nitro-4-phenoxy-5-sulphamoylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Bumetanide Related Compound B (3-Nitro-4-phenoxy-5-sulfamoylbenzoic Acid)
CAS:Sulfonamides, nesoiFormula:C13H10N2O7SColor and Shape:Light Yellow PowderMolecular weight:338.02087BUMETANIDE RELATED COMPOUND B (25 MG) (3-NITRO-4-PHENOXY-5-SULFAMOYLBENZOIC ACID)
CAS:Formula:C13H10N2O7SPurity:95%Color and Shape:SolidMolecular weight:338.29273-Nitro-4-phenoxy-5-sulfamoylbenzoic acid (Bumetanide Impurity)
CAS:3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid (Bumetanide Impurity)Purity:98%Molecular weight:338.29g/molBumetanide EP Impurity A (Bumetanide USP Related Compound B)
CAS:Formula:C13H10N2O7SColor and Shape:Yellow SolidMolecular weight:338.293-Nitro-4-phenoxy-5-sulfamoylbenzoic Acid
CAS:Controlled ProductFormula:C13H10N2O7SColor and Shape:NeatMolecular weight:338.293-Nitro-4-phenoxy-5-sulfamoylbenzoic Acid
CAS:<p>Impurity Bumetanide Impurity A<br>Applications 3-Nitro-4-phenoxy-5-sulfamoylbenzoic Acid is a compound related to Piretanide (P508700) and an intermediate in the production of Bumetanide, Bumetanide Impurity A (B689550).<br></p>Formula:C13H10N2O7SColor and Shape:NeatMolecular weight:338.29









