CAS 2833-30-9
:5-Ethoxy-2(5H)-furanone
Description:
5-Ethoxy-2(5H)-furanone, with the CAS number 2833-30-9, is an organic compound characterized by its furanone structure, which features a five-membered lactone ring. This compound typically exhibits a pale yellow to colorless liquid form and has a distinctive sweet, fruity aroma, often associated with flavoring agents in the food industry. It is soluble in organic solvents and has limited solubility in water. The presence of the ethoxy group enhances its volatility and contributes to its sensory properties. 5-Ethoxy-2(5H)-furanone is primarily used as a flavoring agent and fragrance in various applications, including food products and perfumes. Additionally, it may have potential applications in the field of synthetic organic chemistry as an intermediate in the synthesis of more complex molecules. Its stability under normal conditions makes it a useful compound, although it should be handled with care due to potential reactivity under certain conditions. Overall, its unique characteristics make it a valuable compound in both industrial and research settings.
Formula:C6H8O3
InChI:InChI=1S/C6H8O3/c1-2-8-6-4-3-5(7)9-6/h3-4,6H,2H2,1H3
InChI key:InChIKey=NOZLVOMKFMVAKH-UHFFFAOYSA-N
SMILES:O(CC)C1OC(=O)C=C1
Synonyms:- 2(5H)-furanone, 5-ethoxy-
- 428-330-4
- 5-Ethoxy-2(5H)-furanone
- 5-Ethoxy-2,5-dihydro-2-furanone
- 5-Ethoxy-5H-Furan-2-One
- Crotonic acid, 4-ethoxy-4-hydroxy-, γ-lactone
- T5Ov Ehj Eo2
- β-Formylacrylic acid pseudoethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Ethoxy-2(5H)-furanone
CAS:<p>5-Ethoxy-2(5H)-furanone is an oxidation product of 5-ethoxy-2(5H)-furanone. It has an isomeric, stereospecific, regiospecifically, and a tautomeric relationship with furfural. 5-Ethoxy-2(5H)-furanone can be produced by the oxidation of furfural with boron trifluoride etherate in the presence of iodosobenzene. The reaction mechanism involves the addition of hydrogen peroxide to the boron trifluoride etherate to form hydroperoxydiborane. This compound then reacts with iodosobenzene to produce 5-ethoxy-2(5H)-furanone and 2,5-dihydroxybenzaldehyde. The reaction produces a mixture of diastereomers that contain different numbers of carbon atoms due to the regiospecific</p>Formula:C6H8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:128.13 g/mol
