CAS 2834-91-5
:8-aminonaphthalen-1-ol
Description:
8-Aminonaphthalen-1-ol, with the CAS number 2834-91-5, is an organic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a naphthalene ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water and other polar media. It is often used as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. The presence of the hydroxyl group contributes to its reactivity, allowing for further chemical modifications. Additionally, 8-aminonaphthalen-1-ol exhibits potential biological activity, which may be explored in medicinal chemistry. Safety data indicates that, like many amines and phenolic compounds, it should be handled with care due to potential toxicity and irritant properties. Overall, this compound is significant in both industrial applications and research contexts.
Formula:C10H9NO
InChI:InChI=1/C10H9NO/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,12H,11H2
SMILES:c1cc2cccc(c2c(c1)N)O
Synonyms:- 1-Naphthol, 8-amino-
- 8-Amino-1-naphthol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
8-Aminonaphthalen-1-ol
CAS:<p>8-Aminonaphthalen-1-ol is a synthetic product that is used in the production of nitrobenzene. It is made by reacting sodium carbonate, hydrogen chloride and sodium hydroxide in a liquid chromatograph. The reaction system is heated to 100°C and then cooled to 0°C with the addition of nitric acid. This product has been used for wastewater treatment as it has shown to be effective in removing chlorine from wastewater (chlorides). 8-Aminonaphthalen-1-ol also reduces the concentration of magnesium ions in water when added as a salt.</p>Formula:C10H9NOPurity:Min. 95%Molecular weight:159.18 g/mol
