CAS 28342-31-6
:14-ethoxy-13-methyl-13,14-dihydro[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridine
Description:
14-Ethoxy-13-methyl-13,14-dihydro[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridine, with the CAS number 28342-31-6, is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused aromatic rings and dioxole moieties. This compound is likely to exhibit properties typical of polycyclic aromatic compounds, such as potential fluorescence and varied solubility depending on the solvent used. Its ethoxy and methyl substituents may influence its reactivity and interaction with biological systems, potentially affecting its pharmacological properties. The presence of dioxole rings suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution. Additionally, compounds of this nature may be of interest in medicinal chemistry for their potential therapeutic applications, although specific biological activity would need to be investigated through empirical studies. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of chemical behaviors and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C22H19NO5
InChI:InChI=1/C22H19NO5/c1-3-24-22-19-13(6-7-16-21(19)28-11-25-16)14-5-4-12-8-17-18(27-10-26-17)9-15(12)20(14)23(22)2/h4-9,22H,3,10-11H2,1-2H3
SMILES:CCOC1c2c(ccc3c2OCO3)c2ccc3cc4c(cc3c2N1C)OCO4
Synonyms:- [1,3]Benzodioxolo[5,6-C]-1,3-Dioxolo[4,5-I]Phenanthridine, 14-Ethoxy-13,14-Dihydro-13-Methyl-
- 14-Ethoxy-13-methyl-13,14-dihydro[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethoxysanguinarine
CAS:Ethoxysanguinarine inhibits HuAChE and HuBuChE with IC50s of 0.83 and 4.20 μM, respectively.Formula:C22H19NO5Purity:99.24% - 99.48%Color and Shape:SolidMolecular weight:377.39Ethoxysanguinarine
CAS:Ethoxysanguinarine is a copper complex that has been shown to be an autophagy inducer. It has been shown to activate the surface methodology and increase autophagy, which is a process that eliminates intracellular pathogens in cells. Ethoxysanguinarine also has clinical relevance, as it can be used as a prognosis marker for infectious diseases. The ability of ethoxysanguinarine to bind to DNA polymerase and inhibit its activity may be responsible for its antiviral properties. Ethoxysanguinarine binds to the phosphatase enzyme, which is important for cell signaling pathways and protein synthesis. This binding prevents phosphatases from dephosphorylating membrane-bound receptors that initiate the inflammatory response, leading to suppression of inflammation.Formula:C22H19NO5Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:377.39 g/mol





