CAS 28342-33-8

Oxychelerythrine

Description:

Oxychelerythrine, with the CAS number 28342-33-8, is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant species of the family Amaryllidaceae. This compound is characterized by its complex structure, which includes multiple functional groups that contribute to its biological activity. Oxychelerythrine is known for its potential pharmacological properties, including antitumor and antimicrobial activities, making it of interest in medicinal chemistry and natural product research. The compound typically exhibits solubility in organic solvents, which is common for many alkaloids, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, its interactions with biological systems are an area of ongoing research, as understanding these interactions can lead to the development of new therapeutic agents. Overall, oxychelerythrine represents a fascinating subject for further investigation in both synthetic and natural product chemistry.

Formula: C₂₁H₁₇NO₅

InChI: InChI=1/C21H17NO5/c1-22-19-13(5-4-11-8-16-17(9-14(11)19)27-10-26-16)12-6-7-15(24-2)20(25-3)18(12)21(22)23/h4-9H,10H2,1-3H3

InChI key: InChIKey=IHTXRYTWDARUKX-UHFFFAOYSA-N

SMILES: CN1C2=C(C=3C(C1=O)=C(OC)C(OC)=CC3)C=CC=4C2=CC5=C(C4)OCO5

Synonyms:

• Chelerythrine, 12,13-dihydro-13-oxo-
• Dihydrooxochelerythrine
• Oxychelerythrine
• [1,3]benzodioxolo[5,6-c]phenanthridin-13(12H)-one, 1,2-dimethoxy-12-methyl-
• 1,2-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-13(12H)-one
• 1,2-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-13(12H)-one
• 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one
• 6-Oxochelerythrine

6-Oxochelerythrine

CAS: 28342-33-8

Formula: C₂₁H₁₇NO₅

Purity: 98.0%

Molecular weight: 363.3634

Ref: IN-DA00C4SV

Oxychelerythrine

CAS: 28342-33-8

Oxychelerythrine boosts S. aureus ATCC 6538 antibiotic susceptibility 2-4x and has an EC50 of 192.32 ppm against T. castaneum.

Formula: C₂₁H₁₇NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 363.36

Ref: TM-TN4725

Oxychelerythrine

CAS: 28342-33-8

Formula: C₂₁H₁₇NO₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 363.369

Ref: BP-SBP02704

Oxychelerythrine

CAS: 28342-33-8

Oxychelerythrine is a naturally occurring alkaloid, which is extracted from plants in the Rutaceae family. This compound is a prominent secondary metabolite associated with various biochemical activities. Its mode of action primarily involves the disruption of microbial cell membranes, leading to increased permeability and subsequent cell lysis. This mechanism makes it particularly effective as an antimicrobial agent.

Formula: C₂₁H₁₇NO₅

Purity: Min. 95%

Molecular weight: 363.4 g/mol

Ref: 3D-DBA34233