CAS 28343-61-5: 4-Hydroxy-2,5,6-trichloroisophthalonitrile
Description:4-Hydroxy-2,5,6-trichloroisophthalonitrile, with the CAS number 28343-61-5, is a chemical compound characterized by its structure, which includes a hydroxyl group and multiple chlorine substituents on an isophthalonitrile framework. This compound typically appears as a solid and is known for its stability under various conditions. It exhibits properties such as high thermal stability and resistance to degradation, making it suitable for applications in materials science, particularly in the development of flame retardants and polymers. The presence of chlorine atoms contributes to its reactivity and potential use in synthesis, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with other substances. Additionally, due to its nitrile groups, it may exhibit certain toxicological properties, necessitating careful handling and assessment in industrial applications. Overall, 4-Hydroxy-2,5,6-trichloroisophthalonitrile is a compound of interest in both research and practical applications, particularly in the fields of chemistry and materials engineering.
Formula:C8HCl3N2O
InChI:InChI=1S/C8HCl3N2O/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13/h14H
InChI key:InChIKey=MDQKYGOECVSPIW-UHFFFAOYSA-N
SMILES:N#CC1=C(Cl)C(Cl)=C(O)C(C#N)=C1Cl
- Synonyms:
- 1,3-Benzenedicarbonitrile, 2,4,5-Trichloro-6-Hydroxy-
- 1,3-Dicyano-4-Hydroxy-2,5,6-Trichlorobenzene
- 2,4,5-Trichloro-6-hydroxy-1,3-benzenedicarbonitrile
- 2,4,5-Trichloro-6-hydroxyisophthalonitrile
- 2,5,6-Trichloro-4-hydroxy-1,3-benzenedicarbonitrile
- 28343-61-5
- 4-Hydroxy-2,5,6-trichloroisophthalonitrile
- 4-Hydroxychlorothalonil
- Hydroxychlorothalonil
- Isophthalonitrile, 2,4,5-trichloro-6-hydroxy-
- See more synonyms
- Sds 3701
