CAS 28349-86-2
:Octamethyltrisiloxane homopolymer
Description:
Octamethyltrisiloxane homopolymer, with the CAS number 28349-86-2, is a silicone-based polymer characterized by its unique structure comprising repeating siloxane (Si-O) units. This compound typically exhibits excellent thermal stability, chemical resistance, and low surface tension, making it suitable for various applications in industries such as cosmetics, personal care, and industrial lubricants. Its low viscosity and high flexibility contribute to its effectiveness as a lubricant and conditioning agent. Additionally, octamethyltrisiloxane homopolymer is known for its hydrophobic properties, which enhance water repellency in formulations. The polymer's ability to form a protective barrier on surfaces also makes it valuable in coatings and sealants. Furthermore, it is generally considered non-toxic and biocompatible, which broadens its use in medical and consumer products. Overall, the combination of these characteristics makes octamethyltrisiloxane homopolymer a versatile and widely utilized material in various applications.
Formula:(C8H24O2Si3)x
InChI:InChI=1S/C8H24O2Si3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h1-8H3
InChI key:InChIKey=CXQXSVUQTKDNFP-UHFFFAOYSA-N
SMILES:O([Si](O[Si](C)(C)C)(C)C)[Si](C)(C)C
Synonyms:- Poly(octamethyltrisiloxane)
- Octamethyltrisiloxane polymer
- Trisiloxane, octamethyl-, polymers
- Trisiloxane, 1,1,1,3,3,5,5,5-octamethyl-, homopolymer
- Trisiloxane, octamethyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
