CAS 2835-82-7: β-Aminobutyric acid

Description:β-Aminobutyric acid, also known as 4-aminobutyric acid or GABA (gamma-aminobutyric acid), is a non-proteinogenic amino acid characterized by its role as a neurotransmitter in the central nervous system. It is a colorless, crystalline solid that is soluble in water and exhibits a slightly acidic nature due to the presence of a carboxylic acid group. The molecular structure features a four-carbon backbone with an amino group (-NH2) attached to the second carbon, which distinguishes it from other amino acids. β-Aminobutyric acid is known for its inhibitory effects on neuronal excitability, playing a crucial role in reducing neuronal activity and promoting relaxation. It is involved in various physiological processes, including muscle tone regulation and anxiety reduction. Additionally, β-aminobutyric acid has been studied for its potential therapeutic applications in conditions such as epilepsy, anxiety disorders, and other neurological conditions. Its CAS number, 2835-82-7, is used for identification in chemical databases and regulatory frameworks.

Formula:C₄H₉NO₂

InChI:InChI=1S/C4H9NO2/c1-3(5)2-4(6)7/h3H,2,5H2,1H3,(H,6,7)

InChI key:InChIKey=OQEBBZSWEGYTPG-UHFFFAOYSA-N

SMILES:O=C(O)CC(N)C