CAS 28357-95-1

4-(1-aminoethyl)benzoic acid

Description:

4-(1-Aminoethyl)benzoic acid, also known as para-aminobenzoic acid (PABA) derivative, is an organic compound characterized by its aromatic structure featuring a benzoic acid moiety with an aminoethyl group at the para position. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both the carboxylic acid and amino functional groups. It exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding and form zwitterionic species in solution. The presence of the amino group allows for potential reactivity in various chemical reactions, including acylation and amination. Additionally, 4-(1-aminoethyl)benzoic acid may have applications in pharmaceuticals and biochemistry, particularly in the synthesis of more complex molecules or as a biochemical probe. Its biological activity can be influenced by the aminoethyl side chain, which may affect its interaction with biological targets.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6H,10H2,1H3,(H,11,12)

SMILES: CC(c1ccc(cc1)C(=O)O)N

Synonyms:

• Benzoic Acid, 4-(1-Aminoethyl)-
• 4-(1-Aminoethyl)benzoic acid

4-(1-AMINO-ETHYL)-BENZOIC ACID

CAS: 28357-95-1

Formula: C₉H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA00C3EC

4-(1-aminoethyl)benzoic acid

CAS: 28357-95-1

4-(1-aminoethyl)benzoic acid

Purity: 97%

Molecular weight: 165.19g/mol

Ref: 54-OR94946

4-(1-Aminoethyl)benzoic acid

CAS: 28357-95-1

Formula: C₉H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.192

Ref: 10-F217518