CAS 283584-52-1
:5-Fluoro-3-hydrazonoindolin-2-one
Description:
5-Fluoro-3-hydrazonoindolin-2-one is a chemical compound characterized by its unique structure, which includes an indolinone core with a hydrazone functional group and a fluorine substituent. This compound typically exhibits a solid-state form and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. The hydrazone moiety may contribute to its reactivity and ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Additionally, the compound may display various physical properties such as solubility in organic solvents, which can vary based on the specific conditions. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of more complex pharmaceuticals. Overall, 5-Fluoro-3-hydrazonoindolin-2-one represents a class of compounds that are valuable for research in drug discovery and development.
Formula:C8H6FN3O
InChI:InChI=1/C8H6FN3O/c9-4-1-2-6-5(3-4)7(12-10)8(13)11-6/h1-3H,10H2,(H,11,12,13)
SMILES:c1cc2c(cc1F)C(=NN)C(=O)N2
Synonyms:- 1H-indole-2,3-dione, 5-fluoro-, 3-hydrazone
- 5-Fluoro-3-hydrazono-1,3-dihydro-2H-indol-2-one
- 5-fluoro-3-hydrazinyl-2H-indol-2-one
- 5-Fluoro-3-Hydrazonoeindolin-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Fluoro-3-hydrazonoindolin-2-one
CAS:Formula:C8H6FN3OPurity:96%Color and Shape:SolidMolecular weight:179.15115-Fluoro-3-hydrazonoindolin-2-one
CAS:5-Fluoro-3-hydrazonoindolin-2-one is an organic compound that can be synthesized using ethyl acetate as a solvent and formylation with malate. This process is scalable and offers high yields. The reaction time for this synthesis is relatively short, making it ideal for industrialization. 5-Fluoro-3-hydrazonoindolin-2-one can also be used to synthesize sunitinib, which is an experimental drug used to treat cancer. Sunitinib has been shown to inhibit the growth of cancer cells by interfering with the activity of proteins involved in cell proliferation, cell cycle progression, and cellular differentiation.Formula:C8H6FN3OPurity:Min. 95%Color and Shape:SolidMolecular weight:179.15 g/mol5-Fluoro-1H-indole-2,3-dione 3-Hydrazone
CAS:Controlled ProductFormula:C8H6FN3OColor and Shape:NeatMolecular weight:179.151





