CAS 28360-49-8

(-)-Mahanine

Description:

(-)-Mahanine is a naturally occurring alkaloid primarily derived from the plant Murraya koenigii, commonly known as curry leaf. This compound is characterized by its chiral nature, existing as a specific enantiomer with notable biological activity. (-)-Mahanine exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. The molecular structure of (-)-Mahanine features a complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique chemical behavior and interactions. Its CAS number, 28360-49-8, serves as a unique identifier for this compound in chemical databases, facilitating research and application in various scientific fields. Additionally, (-)-Mahanine's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in formulations and studies. Overall, (-)-Mahanine represents a significant compound in natural product chemistry with promising therapeutic potential.

Formula: C₂₃H₂₅NO₂

InChI: InChI=1S/C23H25NO2/c1-14(2)6-5-10-23(4)11-9-18-21-19(12-15(3)22(18)26-23)17-8-7-16(25)13-20(17)24-21/h6-9,11-13,24-25H,5,10H2,1-4H3/t23-/m1/s1

InChI key: InChIKey=DWMBXHWBPZZCTN-HSZRJFAPSA-N

SMILES: CC1=C2C(=C3C(C=4C(N3)=CC(O)=CC4)=C1)C=C[C@](CCC=C(C)C)(C)O2

Synonyms:

• Mahanine, (-)-
• (3R)-3,11-Dihydro-3,5-dimethyl-3-(4-methyl-3-penten-1-yl)pyrano[3,2-a]carbazol-9-ol
• Pyrano[3,2-a]carbazol-9-ol, 3,11-dihydro-3,5-dimethyl-3-(4-methyl-3-penten-1-yl)-, (3R)-
• Pyrano[3,2-a]carbazol-9-ol, 3,11-dihydro-3,5-dimethyl-3-(4-methyl-3-pentenyl)-, (R)-
• Pyrano[3,2-a]carbazol-9-ol, 3,11-dihydro-3,5-dimethyl-3-(4-methyl-3-pentenyl)-, (3R)-

Mahanine

CAS: 28360-49-8

Formula: C₂₃H₂₅NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 347.4501

Ref: IN-DA00BHWD

Mahanine

CAS: 28360-49-8

Mahanine triggers apoptosis in leukemia, restores gene function in prostate cancer, and may be a promising therapy.

Formula: C₂₃H₂₅NO₂

Color and Shape: Solid

Molecular weight: 347.458

Ref: TM-TN6198

(R)-Mahanine

CAS: 28360-49-8

(R)-Mahanine is a naturally occurring carbazole alkaloid, which is typically extracted from plant sources such as Murraya koenigii (curry tree) and other species within the Rutaceae family. This compound exhibits a unique mode of action by targeting various signaling pathways involved in cancer cell proliferation and survival. Specifically, it has been shown to induce apoptosis, inhibit angiogenesis, and interfere with the cell cycle in malignant cells.

Formula: C₂₃H₂₅NO₂

Purity: Min. 95%

Molecular weight: 347.4 g/mol

Ref: 3D-DBA36049