CAS 28371-16-6
:Aloin B
Description:
Aloin B, with the CAS number 28371-16-6, is a chemical compound that belongs to the class of anthraquinones, which are known for their diverse biological activities. It is primarily derived from the aloe plant, particularly Aloe vera, and is often associated with its laxative properties. Aloin B is characterized by its yellow to brown color and is typically found in the latex of the aloe leaf. This compound exhibits various pharmacological effects, including anti-inflammatory and antimicrobial properties, making it of interest in both traditional medicine and modern pharmacology. Aloin B is also studied for its potential antioxidant effects, which may contribute to its therapeutic applications. However, it is important to note that while it has beneficial properties, excessive consumption can lead to adverse effects, particularly gastrointestinal discomfort. As with many natural compounds, the safety and efficacy of Aloin B depend on dosage and individual health conditions.
Formula:C21H22O9
InChI:InChI=1/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13?,14-,17?,19?,20?,21?/m0/s1
InChI key:InChIKey=AFHJQYHRLPMKHU-WEZNYRQKSA-N
SMILES:O[C@H]1[C@]([C@]2(C=3C(C(=O)C=4C2=CC=CC4O)=C(O)C=C(CO)C3)[H])(O[C@H](CO)[C@@H](O)[C@@H]1O)[H]
Synonyms:- Isobarbaloin
- (10R)-10-β-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone
- 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-, (10R)-
- Anthrone, 10-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-, stereoisomer
- 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-, (R)-
- Aloin B, 98%, from Aloe vera (L.) Burm.f. var. chinensis (Haw.) A. Berger
- (R)-10-(β-D-Glucopyranosyl)-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone
- 9(10H)-Anthracenone,10-β-D-glucopyranosyl-1,8-
- Aloin B (Aloin-B
- (R)-10-(β-D-Glucopyranosyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracen-9(10H)-one
- ALOIN B(P)
- dihydroxy-3-(hydroxymethyl)-,(R)-
- Aloin B, >99%
- ALOIN B
- ALOIN B; ISOBARBALOIN
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
Aloin B
CAS:Aloin B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H22O9Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:418.4Aloin B
CAS:Other glycosides, natural or reproduced by synthesis, and their salts, ethers, esters and other derivativesFormula:C21H22O9Color and Shape:Yellow Crystalline PowderMolecular weight:418.12638Aloin B
CAS:Dietary supplementation of aloe components (aloin, aloesin and aloe-gel) can ameliorate intestinal inflammatory responses in a 3% dextran sulfate sodium (DSS)-induced ulcerative colitis rat model, in particular, aloesin is the most potent inhibitor. The extract of A. vera and its active ingredient aloin cause melanin aggregation leading to skin lightening via alpha adrenergic receptor stimulation.Formula:C21H22O9Purity:95%~99%Molecular weight:418.398Aloin B
CAS:Aloin B (Isobarbaloin) is an isomer of aloin.1.Formula:C21H22O9Purity:98.03% - 99.77%Color and Shape:SolidMolecular weight:418.39Aloin B
CAS:Natural glycosideFormula:C21H22O9Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:418.4(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4,5,10-trihydroxy-2-(hydroxymethyl)anthracen-9-yl]oxane-3,4,5-triol
CAS:Purity:95%Molecular weight:418.398010253906Aloin B
CAS:Controlled ProductApplications Aloin B is an aloe exudate and a phytochemical constituent. It is one isomer of Aloin, the other being Aloin A (A575415)
References Sun, Ya Nan, et al.: Nat. Prod. Res., 31(23), 2810-2813 (2017);Lucini, Luigi, et al.: Food Chem., 170, 501-507 (2015)Formula:C21H22O9Color and Shape:NeatMolecular weight:418.39Aloin B
CAS:Aloin B is a natural anthraquinone glycoside, which is derived from the leaves of the Aloe plant, specifically species such as Aloe vera and Aloe ferox. It is a C-glucoside of aloe-emodin and functions primarily by exerting a stimulant laxative effect. This mode of action is achieved through its influence on the colon, where it promotes peristalsis and intestinal motility by irritating the colonic wall, thereby increasing bowel movement frequency.
Formula:C21H22O9Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:418.39 g/mol













