CAS 28374-71-2
:5-Hydroxy-2,2,6-tris(3-methyl-2-buten-1-yl)-4-(2-methyl-1-oxobutyl)-4-cyclohexene-1,3-dione
Description:
5-Hydroxy-2,2,6-tris(3-methyl-2-buten-1-yl)-4-(2-methyl-1-oxobutyl)-4-cyclohexene-1,3-dione, with CAS number 28374-71-2, is an organic compound characterized by its complex structure, which includes multiple functional groups and a cyclohexene ring. This compound features hydroxyl (-OH) and carbonyl (C=O) groups, contributing to its reactivity and potential biological activity. The presence of multiple isoprenoid side chains suggests that it may exhibit lipophilic properties, influencing its solubility in organic solvents. Its molecular structure indicates potential applications in fields such as pharmaceuticals or agrochemicals, where compounds with similar frameworks are often explored for their biological activities. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C26H38O4
InChI:InChI=1S/C26H38O4/c1-9-19(8)22(27)21-23(28)20(11-10-16(2)3)24(29)26(25(21)30,14-12-17(4)5)15-13-18(6)7/h10,12-13,19-20,28H,9,11,14-15H2,1-8H3
InChI key:InChIKey=FHYRSQGERVECQU-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1(CC=C(C)C)C(=O)C(C(C(CC)C)=O)=C(O)C(CC=C(C)C)C1=O
Synonyms:- Adlupulone
- 5-Hydroxy-2,2,6-tris(3-methyl-2-buten-1-yl)-4-(2-methyl-1-oxobutyl)-4-cyclohexene-1,3-dione
- 4-Cyclohexene-1,3-dione, 5-hydroxy-2,2,6-tris(3-methyl-2-butenyl)-4-(2-methyl-1-oxobutyl)-
- 4-Cyclohexene-1,3-dione, 5-hydroxy-2,2,6-tris(3-methyl-2-butenyl)-4-(2-methylbutyryl)-
- 4-Cyclohexene-1,3-dione, 5-hydroxy-2,2,6-tris(3-methyl-2-buten-1-yl)-4-(2-methyl-1-oxobutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Adlupulone
CAS:Adlupulone is a bioactive chemical.Formula:C26H38O4Color and Shape:SolidMolecular weight:414.58
